The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-{benzyl[2-(dimethylamino)ethyl]sulfamoyl}phenyl)-1-(3-chloro-4-methylphenyl)urea ID: ALA3753329
PubChem CID: 127029488
Max Phase: Preclinical
Molecular Formula: C25H29ClN4O3S
Molecular Weight: 501.05
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)Nc2ccc(S(=O)(=O)N(CCN(C)C)Cc3ccccc3)cc2)cc1Cl
Standard InChI: InChI=1S/C25H29ClN4O3S/c1-19-9-10-22(17-24(19)26)28-25(31)27-21-11-13-23(14-12-21)34(32,33)30(16-15-29(2)3)18-20-7-5-4-6-8-20/h4-14,17H,15-16,18H2,1-3H3,(H2,27,28,31)
Standard InChI Key: VRLOQYKKBMKSEG-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
3.8933 -3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8341 -10.3548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8756 -9.7587 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.8709 -10.9587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7722 -10.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0763 -9.7859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4764 -9.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1723 -10.5144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1671 -12.0152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1124 -10.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0830 -8.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4638 -12.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4608 -14.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7583 -15.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0588 -14.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0619 -12.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7644 -12.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8808 -8.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1824 -7.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1876 -6.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5895 -6.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5844 -7.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 2 0
12 11 2 0
13 12 2 0
14 15 1 0
14 16 1 0
16 17 1 0
17 18 1 0
15 19 1 0
15 20 1 0
18 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
17 12 1 0
12 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 1 1 0
9 33 1 0
10 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.05Molecular Weight (Monoisotopic): 500.1649AlogP: 5.04#Rotatable Bonds: 9Polar Surface Area: 81.75Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.15CX Basic pKa: 7.54CX LogP: 5.03CX LogD: 4.65Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -1.87
References 1. Éliás O, Nógrádi K, Domány G, Szakács Z, Kóti J, Szántay C, Tarcsay Á, Keserű GM, Gere A, Kiss B, Kurkó D, Kolok S, Némethy Z, Kapui Z, Hellinger É, Vastag M, Sághy K, Kedves R, Gyertyán I.. (2016) The influence of 5-HT(2A) activity on a 5-HT(2C) specific in vivo assay used for early identification of multiple acting SERT and 5-HT(2C) receptor ligands., 26 (3): [PMID:26748694 ] [10.1016/j.bmcl.2015.12.071 ]