The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-{benzyl[2-(dimethylamino)ethyl]sulfamoyl}phenyl)-3-(1-ethyl-1H-indol-5-yl)urea ID: ALA3753516
PubChem CID: 127029486
Max Phase: Preclinical
Molecular Formula: C28H33N5O3S
Molecular Weight: 519.67
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCn1ccc2cc(NC(=O)Nc3ccc(S(=O)(=O)N(CCN(C)C)Cc4ccccc4)cc3)ccc21
Standard InChI: InChI=1S/C28H33N5O3S/c1-4-32-17-16-23-20-25(12-15-27(23)32)30-28(34)29-24-10-13-26(14-11-24)37(35,36)33(19-18-31(2)3)21-22-8-6-5-7-9-22/h5-17,20H,4,18-19,21H2,1-3H3,(H2,29,30,34)
Standard InChI Key: OSDICVXSLODULB-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-6.2216 1.4644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 1.4865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9050 -0.4745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.3771 -2.7869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.3898 -1.5870 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-12.4225 -2.1981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.0252 1.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0442 2.8854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-12.7166 0.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.6976 -0.8508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.9896 -1.6145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.0905 3.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0124 3.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.2975 -0.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.5899 -1.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.8955 -0.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.9088 0.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.6164 1.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.3108 0.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0978 -0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1132 0.6766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8219 1.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5151 0.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4999 -0.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7911 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3606 -2.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 2 0
6 10 1 0
9 7 1 0
7 8 2 0
8 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
13 14 1 0
16 15 2 0
17 16 2 0
18 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
19 23 1 0
19 24 1 0
22 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
21 16 1 0
16 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 1 1 0
14 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.67Molecular Weight (Monoisotopic): 519.2304AlogP: 5.06#Rotatable Bonds: 10Polar Surface Area: 86.68Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.11CX Basic pKa: 7.54CX LogP: 4.59CX LogD: 4.22Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: -1.77
References 1. Éliás O, Nógrádi K, Domány G, Szakács Z, Kóti J, Szántay C, Tarcsay Á, Keserű GM, Gere A, Kiss B, Kurkó D, Kolok S, Némethy Z, Kapui Z, Hellinger É, Vastag M, Sághy K, Kedves R, Gyertyán I.. (2016) The influence of 5-HT(2A) activity on a 5-HT(2C) specific in vivo assay used for early identification of multiple acting SERT and 5-HT(2C) receptor ligands., 26 (3): [PMID:26748694 ] [10.1016/j.bmcl.2015.12.071 ]