(R)-N-[(5-Nitro-1H-indol-2-yl)methyl]-1-(1-naphthyl)ethanamine

ID: ALA3753550

PubChem CID: 57385593

Max Phase: Preclinical

Molecular Formula: C21H19N3O2

Molecular Weight: 345.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](NCc1cc2cc([N+](=O)[O-])ccc2[nH]1)c1cccc2ccccc12

Standard InChI:  InChI=1S/C21H19N3O2/c1-14(19-8-4-6-15-5-2-3-7-20(15)19)22-13-17-11-16-12-18(24(25)26)9-10-21(16)23-17/h2-12,14,22-23H,13H2,1H3/t14-/m1/s1

Standard InChI Key:  JHGFQITYJOLVST-CQSZACIVSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   -1.2896    2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3263    3.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0131    3.7434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0200    5.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4761    7.4707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3227    5.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6465    5.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6674    6.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1709    6.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9455    7.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2184    9.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6990    9.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9403    7.7640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4462    7.7152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0540    8.7499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0388    6.6717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  1  3  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  4 13  2  0
  8 13  1  0
  1  4  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 15 23  1  0
 18 23  2  0
 24 25  2  0
 24 26  1  0
 20 24  1  0
 14 16  1  0
  3 14  1  0
M  CHG  2  24   1  26  -1
M  END

Associated Targets(non-human)

Casr Calcium sensing receptor (198 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 345.40Molecular Weight (Monoisotopic): 345.1477AlogP: 5.08#Rotatable Bonds: 5
Polar Surface Area: 70.96Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.81CX LogP: 4.62CX LogD: 3.20
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.39Np Likeness Score: -1.27

References

1. Kiefer L, Beaumard F, Gorojankina T, Faure H, Ruat M, Dodd RH..  (2016)  Design and synthesis of calindol derivatives as potent and selective calcium sensing receptor agonists.,  24  (4): [PMID:26752095] [10.1016/j.bmc.2015.12.019]

Source