The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((2-Chloroacridin-9-yl)amino)phenyl)-3-(p-tolyl)thiourea ID: ALA3754162
PubChem CID: 127036862
Max Phase: Preclinical
Molecular Formula: C27H21ClN4S
Molecular Weight: 469.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=S)Nc2ccc(Nc3c4ccccc4nc4ccc(Cl)cc34)cc2)cc1
Standard InChI: InChI=1S/C27H21ClN4S/c1-17-6-9-20(10-7-17)30-27(33)31-21-13-11-19(12-14-21)29-26-22-4-2-3-5-24(22)32-25-15-8-18(28)16-23(25)26/h2-16H,1H3,(H,29,32)(H2,30,31,33)
Standard InChI Key: DXRFCBBMIOWWGE-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-3.8968 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8968 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5978 -1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5978 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2989 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2989 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2806 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2806 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 -0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8968 0.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 1.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0058 3.0010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2905 3.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2869 5.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5840 6.0106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8849 5.2638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8887 3.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5915 3.0106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1844 6.0148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4849 5.2657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7844 6.0167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4858 4.0657 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-9.0849 5.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3847 6.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6831 5.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6816 3.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3818 3.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0835 3.7676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9360 1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-12.7202 3.1641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
8 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
1 32 1 0
29 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.01Molecular Weight (Monoisotopic): 468.1175AlogP: 7.90#Rotatable Bonds: 4Polar Surface Area: 48.98Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.77CX Basic pKa: 7.60CX LogP: 8.10CX LogD: 7.70Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.18Np Likeness Score: -1.25
References 1. Medapi B, Meda N, Kulkarni P, Yogeeswari P, Sriram D.. (2016) Development of acridine derivatives as selective Mycobacterium tuberculosis DNA gyrase inhibitors., 24 (4): [PMID:26787274 ] [10.1016/j.bmc.2016.01.011 ]