N-benzyl-3-[4-(3-chlorophenyl)piperazin-1-yl]-N-[2-(dimethylamino)ethyl]benzene-1-sulfonamide

ID: ALA3754784

PubChem CID: 127026349

Max Phase: Preclinical

Molecular Formula: C27H33ClN4O2S

Molecular Weight: 513.11

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCN(Cc1ccccc1)S(=O)(=O)c1cccc(N2CCN(c3cccc(Cl)c3)CC2)c1

Standard InChI:  InChI=1S/C27H33ClN4O2S/c1-29(2)14-19-32(22-23-8-4-3-5-9-23)35(33,34)27-13-7-12-26(21-27)31-17-15-30(16-18-31)25-11-6-10-24(28)20-25/h3-13,20-21H,14-19,22H2,1-2H3

Standard InChI Key:  CBWBSLUIEODKRP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9015    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2352    0.8946    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.5359   -1.3582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4978   -0.7562    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5383   -0.1583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2094    3.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9126    3.7566    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2044    1.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5012    0.7446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8021    1.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9166    4.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8712    3.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8055    2.9938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1046    3.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1049    5.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8060    5.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5068    5.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5065    3.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 11 13  1  0
 15 14  2  0
 16 15  2  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 18 22  1  0
 18 23  1  0
 21 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 20 15  1  0
 15 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 32  1  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3754784

    ---

Associated Targets(non-human)

Htr2c Serotonin 2c (5-HT2c) receptor (1134 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc6a4 Serotonin transporter (6087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.11Molecular Weight (Monoisotopic): 512.2013AlogP: 4.42#Rotatable Bonds: 9
Polar Surface Area: 47.10Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.54CX LogP: 5.22CX LogD: 4.84
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.42Np Likeness Score: -1.65

References

1. Éliás O, Nógrádi K, Domány G, Szakács Z, Kóti J, Szántay C, Tarcsay Á, Keserű GM, Gere A, Kiss B, Kurkó D, Kolok S, Némethy Z, Kapui Z, Hellinger É, Vastag M, Sághy K, Kedves R, Gyertyán I..  (2016)  The influence of 5-HT(2A) activity on a 5-HT(2C) specific in vivo assay used for early identification of multiple acting SERT and 5-HT(2C) receptor ligands.,  26  (3): [PMID:26748694] [10.1016/j.bmcl.2015.12.071]

Source