The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
berkchaetoazaphilone B ID: ALA3759602
PubChem CID: 127028675
Max Phase: Preclinical
Molecular Formula: C25H32O7
Molecular Weight: 444.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCC(=O)[C@@]12O[C@@]13C1=COC(C[C@H](C)O)=CC1=CC(=O)[C@]3(C)OC2=O
Standard InChI: InChI=1S/C25H32O7/c1-4-5-6-7-8-9-10-11-20(27)24-22(29)31-23(3)21(28)14-17-13-18(12-16(2)26)30-15-19(17)25(23,24)32-24/h13-16,26H,4-12H2,1-3H3/t16-,23-,24-,25+/m0/s1
Standard InChI Key: YEGUZQUADBNQFP-NBQXJWNKSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-7.4200 3.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4200 1.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8000 3.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1100 4.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8000 1.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1100 1.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1100 -0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8000 -1.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5000 -0.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0600 -0.7900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2400 0.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7842 -2.2799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0401 0.4234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1214 2.7244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3724 -1.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7209 4.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7244 5.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6863 6.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.7646 6.2474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5000 1.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1000 1.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1600 2.6100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2906 2.4543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6832 4.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7066 5.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2685 6.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2918 7.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8537 9.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8770 10.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4389 11.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4623 12.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1119 14.0052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 4 1 0
2 6 1 0
5 3 2 0
3 4 1 0
5 6 1 0
5 20 1 0
6 7 2 0
7 8 1 0
8 9 1 0
20 9 1 0
9 10 1 0
10 11 1 0
11 21 1 0
8 12 2 0
11 13 2 0
21 14 1 6
9 15 1 6
1 16 1 0
16 17 1 0
17 18 1 0
17 19 1 1
21 20 1 0
21 22 1 0
20 22 1 1
14 23 2 0
14 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.52Molecular Weight (Monoisotopic): 444.2148AlogP: 3.60#Rotatable Bonds: 11Polar Surface Area: 102.43Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.62CX LogD: 3.62Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.22Np Likeness Score: 1.68
References 1. Stierle AA, Stierle DB, Girtsman T, Mou TC, Antczak C, Djaballah H.. (2015) Azaphilones from an Acid Mine Extremophile Strain of a Pleurostomophora sp., 78 (12): [PMID:26641525 ] [10.1021/acs.jnatprod.5b00519 ]