1-((1H-Benzo[d]1,2,3-triazol-1-yl)methyl)-3-(butyl)-benzimidazolium chloride

ID: ALA3760112

PubChem CID: 127028327

Max Phase: Preclinical

Molecular Formula: C18H20ClN5

Molecular Weight: 306.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC[n+]1cn(Cn2nnc3ccccc32)c2ccccc21.[Cl-]

Standard InChI:  InChI=1S/C18H20N5.ClH/c1-2-3-12-21-13-22(18-11-7-6-10-17(18)21)14-23-16-9-5-4-8-15(16)19-20-23;/h4-11,13H,2-3,12,14H2,1H3;1H/q+1;/p-1

Standard InChI Key:  GZHZKGIQLNPGCM-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    9.1402   -1.1038    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1182    4.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2926    4.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6552   -2.9294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7165   -1.9222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0283   -2.6552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7345   -4.1193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2488   -4.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6328   -5.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5406   -6.8774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0262   -6.7101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6402   -5.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  2  6  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4  7  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  3 11  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 16 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 19 24  2  0
 20 21  2  0
 15 16  1  0
  6 15  1  0
M  CHG  2   1  -1   3   1
M  END

Associated Targets(Human)

PON1 Tbio Serum paraoxonase/arylesterase 1 (96 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 306.39Molecular Weight (Monoisotopic): 306.1713AlogP: 2.98#Rotatable Bonds: 5
Polar Surface Area: 39.52Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.33CX LogP: 0.27CX LogD: 0.27
Aromatic Rings: 4Heavy Atoms: 23QED Weighted: 0.53Np Likeness Score: -1.09

References

1. Karataş MO, Uslu H, Alıcı B, Gökçe B, Gencer N, Arslan O, Arslan NB, Özdemir N..  (2016)  Functionalized imidazolium and benzimidazolium salts as paraoxonase 1 inhibitors: Synthesis, characterization and molecular docking studies.,  24  (6): [PMID:26879855] [10.1016/j.bmc.2016.02.012]

Source