The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-O-di[4-(4,5-dihydro-5-oxo-4H-1,2,4-oxadiazol-3-yl)methylphenyl]-2-O-pentylglycerol ID: ALA376244
PubChem CID: 135540817
Max Phase: Preclinical
Molecular Formula: C26H30N4O7
Molecular Weight: 510.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCOC(COc1ccc(Cc2noc(=O)[nH]2)cc1)COc1ccc(Cc2noc(=O)[nH]2)cc1
Standard InChI: InChI=1S/C26H30N4O7/c1-2-3-4-13-33-22(16-34-20-9-5-18(6-10-20)14-23-27-25(31)36-29-23)17-35-21-11-7-19(8-12-21)15-24-28-26(32)37-30-24/h5-12,22H,2-4,13-17H2,1H3,(H,27,29,31)(H,28,30,32)
Standard InChI Key: YZLZEXBVVJLLBY-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
10.0957 -20.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7444 -20.5091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4276 -20.0512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2042 -19.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3853 -19.2227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7157 -18.6059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5795 -13.7874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2476 -14.2791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9072 -13.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6708 -13.0184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8431 -13.0044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1634 -12.3568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2324 -19.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9485 -20.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6686 -19.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6737 -19.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9543 -18.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2370 -19.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5270 -18.7302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8006 -18.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5157 -19.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2321 -18.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9432 -19.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6596 -18.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3747 -19.1184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8100 -19.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0987 -18.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1113 -17.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8311 -17.4926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8437 -16.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5586 -16.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5665 -15.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8562 -15.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1364 -15.4276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1322 -16.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8626 -14.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3796 -20.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
19 18 1 0
7 8 2 0
9 10 1 0
20 21 1 0
10 11 1 0
21 22 1 0
11 7 1 0
22 23 1 0
23 24 1 0
10 12 2 0
24 25 1 0
4 6 2 0
2 3 1 0
26 27 1 0
27 25 1 0
26 19 1 0
13 14 2 0
27 28 1 0
8 9 1 0
28 29 1 0
14 15 1 0
29 30 1 0
1 2 2 0
30 31 2 0
15 16 2 0
31 32 1 0
3 4 1 0
32 33 2 0
16 17 1 0
33 34 1 0
4 5 1 0
34 35 2 0
35 30 1 0
17 18 2 0
33 36 1 0
36 7 1 0
18 13 1 0
15 37 1 0
37 1 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.55Molecular Weight (Monoisotopic): 510.2114AlogP: 3.25#Rotatable Bonds: 15Polar Surface Area: 145.47Molecular Species: ACIDHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 5.70CX Basic pKa: ┄CX LogP: 4.58CX LogD: 2.92Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -0.32
References 1. Touaibia M, Djimdé A, Cao F, Boilard E, Bezzine S, Lambeau G, Redeuilh C, Lamouri A, Massicot F, Chau F, Dong CZ, Heymans F.. (2007) Inhibition of secreted phospholipase A2. 4-glycerol derivatives of 4,5-dihydro-3-(4-tetradecyloxybenzyl)-1,2,4-4H-oxadiazol-5-one with broad activities., 50 (7): [PMID:17335183 ] [10.1021/jm060082n ]