The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-fluoro-4,4'-bis((4-methyl-1,4-diazepan-1-yl)methyl)-[1,1'-biphenyl]-2-carbonitrile ID: ALA3763931
PubChem CID: 117610137
Max Phase: Preclinical
Molecular Formula: C27H36FN5
Molecular Weight: 449.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCCN(Cc2ccc(-c3ccc(CN4CCCN(C)CC4)cc3C#N)c(F)c2)CC1
Standard InChI: InChI=1S/C27H36FN5/c1-30-9-3-11-32(15-13-30)20-22-5-7-25(24(17-22)19-29)26-8-6-23(18-27(26)28)21-33-12-4-10-31(2)14-16-33/h5-8,17-18H,3-4,9-16,20-21H2,1-2H3
Standard InChI Key: IIVUZDODNKDQAS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
2.5660 -3.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0032 -4.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4644 -5.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4884 -3.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0512 -2.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5900 -2.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9018 -6.4622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3636 -6.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8031 -8.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7808 -9.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3191 -8.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8796 -7.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1497 -0.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2897 1.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2176 -10.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1932 -11.8634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7224 -13.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9655 -14.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7508 -11.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4811 -14.7854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5070 -12.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3869 -13.7594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2676 -14.1919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7102 -7.2909 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9786 -5.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1594 -6.6614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
6 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 1 0
16 18 1 0
17 19 1 0
18 20 1 0
19 20 1 0
18 21 1 0
10 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
25 27 1 0
26 28 1 0
27 29 1 0
28 29 1 0
29 30 1 0
12 31 1 0
32 33 3 0
2 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.62Molecular Weight (Monoisotopic): 449.2955AlogP: 3.64#Rotatable Bonds: 5Polar Surface Area: 36.75Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.06CX LogP: 3.32CX LogD: 0.57Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.70Np Likeness Score: -1.20
References 1. Zech SG, Kohlmann A, Zhou T, Li F, Squillace RM, Parillon LE, Greenfield MT, Miller DP, Qi J, Thomas RM, Wang Y, Xu Y, Miret JJ, Shakespeare WC, Zhu X, Dalgarno DC.. (2016) Novel Small Molecule Inhibitors of Choline Kinase Identified by Fragment-Based Drug Discovery., 59 (2): [PMID:26700752 ] [10.1021/acs.jmedchem.5b01552 ]