The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methyl-N'-(4-phenoxybenzoyl)benzo[d]imidazo[2,1-b]thiazole-3-carbohydrazide ID: ALA3764865
PubChem CID: 127041667
Max Phase: Preclinical
Molecular Formula: C24H18N4O3S
Molecular Weight: 442.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2sc3ccccc3n2c1C(=O)NNC(=O)c1ccc(Oc2ccccc2)cc1
Standard InChI: InChI=1S/C24H18N4O3S/c1-15-21(28-19-9-5-6-10-20(19)32-24(28)25-15)23(30)27-26-22(29)16-11-13-18(14-12-16)31-17-7-3-2-4-8-17/h2-14H,1H3,(H,26,29)(H,27,30)
Standard InChI Key: LZZONHDLBQLCTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-0.4399 -1.9215 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.7408 -1.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3010 0.3704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2039 0.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6669 -1.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2688 -1.0186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7318 0.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5048 1.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1485 -1.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1672 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6810 1.1807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2225 1.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4974 2.7711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4550 3.3656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7929 3.5288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7854 5.0296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0809 5.7874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0734 7.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3672 8.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3566 9.5474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0523 10.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7586 9.5291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7691 8.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1233 5.1929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0387 11.7890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7326 12.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7168 14.0283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4100 14.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1189 14.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1346 12.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4414 11.7648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8756 0.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
2 6 2 0
3 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
4 12 2 0
5 9 2 0
15 16 1 0
13 14 2 0
13 15 1 0
8 13 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
17 24 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
25 26 1 0
21 25 1 0
16 17 1 0
7 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.50Molecular Weight (Monoisotopic): 442.1100AlogP: 4.72#Rotatable Bonds: 4Polar Surface Area: 84.73Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.52CX Basic pKa: 2.52CX LogP: 3.59CX LogD: 3.58Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.52
References 1. Samala G, Devi PB, Saxena S, Meda N, Yogeeswari P, Sriram D.. (2016) Design, synthesis and biological evaluation of imidazo[2,1-b]thiazole and benzo[d]imidazo[2,1-b]thiazole derivatives as Mycobacterium tuberculosis pantothenate synthetase inhibitors., 24 (6): [PMID:26867485 ] [10.1016/j.bmc.2016.01.059 ]