5-p-methoxybenzylaminocamptothecin

ID: ALA376525

PubChem CID: 44420343

Max Phase: Preclinical

Molecular Formula: C28H25N3O5

Molecular Weight: 483.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 5-P-Methoxybenzylaminocamptothecin | CHEMBL376525|5-p-methoxybenzylaminocamptothecin

Canonical SMILES:  CC[C@@]1(O)C(=O)OCc2c1c(NCc1ccc(OC)cc1)c1n(c2=O)Cc2cc3ccccc3nc2-1

Standard InChI:  InChI=1S/C28H25N3O5/c1-3-28(34)22-20(15-36-27(28)33)26(32)31-14-18-12-17-6-4-5-7-21(17)30-23(18)25(31)24(22)29-13-16-8-10-19(35-2)11-9-16/h4-12,29,34H,3,13-15H2,1-2H3/t28-/m0/s1

Standard InChI Key:  HNGWPGHCVGWIDE-NDEPHWFRSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  1  0  0  0  0  0999 V2000
   -5.2114   -2.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2125   -3.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5369   -3.9170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5386   -2.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8625   -2.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8617   -3.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1857   -3.9112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1911   -2.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5144   -2.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5114   -3.5207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9096   -2.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2325   -2.6821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2353   -3.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5200   -3.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5188   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1971   -2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1984   -3.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9165   -3.9228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6338   -3.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6284   -2.6733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9098   -2.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4964   -4.5052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3308   -4.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5388   -5.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3540   -3.9177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5197   -1.4444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5208   -4.7527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2373   -5.1654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2380   -5.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9559   -6.3997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9570   -7.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2407   -7.6407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5218   -7.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5243   -6.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2404   -8.4685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9571   -8.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
 16 17  2  0
  9  8  2  0
 17 18  1  0
  8  5  1  0
 18 19  1  0
  9 10  1  0
 19 20  1  0
  5  4  2  0
 20 21  1  0
 21 16  1  0
  4  1  1  0
 18 22  1  1
 18 23  1  0
 10 13  1  0
 23 24  1  0
 12 11  1  0
 19 25  2  0
 11  9  1  0
 15 26  2  0
  2  3  1  0
 14 27  1  0
  5  6  1  0
 27 28  1  0
 12 13  1  0
 28 29  1  0
  3  6  2  0
 29 30  2  0
 13 14  2  0
 30 31  1  0
 14 17  1  0
 31 32  2  0
  6  7  1  0
 32 33  1  0
 16 15  1  0
 33 34  2  0
 34 29  1  0
 15 12  1  0
 32 35  1  0
  7 10  2  0
 35 36  1  0
M  END

Alternative Forms

Associated Targets(Human)

LNCaP C4-2 (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.52Molecular Weight (Monoisotopic): 483.1794AlogP: 3.70#Rotatable Bonds: 5
Polar Surface Area: 102.68Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.64CX Basic pKa: 1.80CX LogP: 2.18CX LogD: 2.18
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: 0.13

References

1. Torregrossa J, Bubley GJ, Jones GB..  (2006)  Microwave expedited synthesis of 5-aminocamptothecin analogs: Inhibitors of hypoxia inducible factor HIF-1alpha.,  16  (23): [PMID:16971123] [10.1016/j.bmcl.2006.08.103]

Source