The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(4-(((2S,5R)-5-((R)-Hydroxy(phenyl)methyl)pyrrolidin-2-yl)-methyl)phenyl)-2-(6-oxopyridazin-1(6H)-yl)propanamide ID: ALA3765335
PubChem CID: 127037832
Max Phase: Preclinical
Molecular Formula: C25H28N4O3
Molecular Weight: 432.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](C(=O)Nc1ccc(C[C@@H]2CC[C@H]([C@H](O)c3ccccc3)N2)cc1)n1ncccc1=O
Standard InChI: InChI=1S/C25H28N4O3/c1-17(29-23(30)8-5-15-26-29)25(32)28-20-11-9-18(10-12-20)16-21-13-14-22(27-21)24(31)19-6-3-2-4-7-19/h2-12,15,17,21-22,24,27,31H,13-14,16H2,1H3,(H,28,32)/t17-,21-,22+,24+/m0/s1
Standard InChI Key: PBXGYXYBIGMVQD-KBABAZTHSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2809 -2.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2755 -3.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0234 -4.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4911 -4.4637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4090 -6.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0841 -6.2921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7012 -7.6593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1938 -7.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0693 -6.5906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4523 -5.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9597 -5.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5630 -6.7368 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4373 -5.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9417 -4.4240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4603 -3.5054 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.9309 -5.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8052 -4.4433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1835 -3.0781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0548 -1.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2983 -4.5873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7957 -5.6793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1696 -3.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5479 -2.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4265 -6.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 1 6
8 10 1 0
10 11 1 0
12 11 1 0
12 13 1 0
13 8 1 0
12 14 1 1
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 1 0
22 23 2 0
8 24 1 6
22 25 1 0
25 26 1 0
26 27 1 0
26 29 1 0
27 28 2 0
28 32 1 0
31 29 1 0
29 30 2 0
31 32 2 0
25 33 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.52Molecular Weight (Monoisotopic): 432.2161AlogP: 2.84#Rotatable Bonds: 7Polar Surface Area: 96.25Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.55CX Basic pKa: 10.61CX LogP: 2.62CX LogD: -0.31Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -0.57
References 1. Edmondson SD, Zhu C, Kar NF, Di Salvo J, Nagabukuro H, Sacre-Salem B, Dingley K, Berger R, Goble SD, Morriello G, Harper B, Moyes CR, Shen DM, Wang L, Ball R, Fitzmaurice A, Frenkl T, Gichuru LN, Ha S, Hurley AL, Jochnowitz N, Levorse D, Mistry S, Miller RR, Ormes J, Salituro GM, Sanfiz A, Stevenson AS, Villa K, Zamlynny B, Green S, Struthers M, Weber AE.. (2016) Discovery of Vibegron: A Potent and Selective β3 Adrenergic Receptor Agonist for the Treatment of Overactive Bladder., 59 (2): [PMID:26709102 ] [10.1021/acs.jmedchem.5b01372 ]