The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(2,4-dimethylphenylsulfonyl)-6-oxo-1,4,5,6-tetrahydropyrimidin-2-ylthio)-N-(2-(trifluoromethyl)phenyl)acetamide ID: ALA3769594
PubChem CID: 127027484
Max Phase: Preclinical
Molecular Formula: C21H20F3N3O4S2
Molecular Weight: 499.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)C2CN=C(SCC(=O)Nc3ccccc3C(F)(F)F)NC2=O)c(C)c1
Standard InChI: InChI=1S/C21H20F3N3O4S2/c1-12-7-8-16(13(2)9-12)33(30,31)17-10-25-20(27-19(17)29)32-11-18(28)26-15-6-4-3-5-14(15)21(22,23)24/h3-9,17H,10-11H2,1-2H3,(H,26,28)(H,25,27,29)
Standard InChI Key: XOPFQYDVMAQHLG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0388 3.6015 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0006 4.2008 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 -0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0994 0.7387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.3984 1.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3985 2.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0995 3.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8004 2.9887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.4377 0.8886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.6983 3.7390 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-12.9985 2.9894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9994 1.4894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2989 0.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5975 1.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5965 2.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2971 3.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.9605 0.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.6371 0.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6979 4.9390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.6590 4.3389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 9 1 0
7 10 1 0
3 7 1 0
4 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 21 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
18 22 2 0
19 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
25 30 1 0
27 31 1 0
23 32 2 0
23 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.54Molecular Weight (Monoisotopic): 499.0847AlogP: 3.32#Rotatable Bonds: 5Polar Surface Area: 104.70Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.51CX Basic pKa: 3.93CX LogP: 4.09CX LogD: 4.05Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.66Np Likeness Score: -1.67