2-(5-(2,4-dimethylphenylsulfonyl)-6-oxo-1,4,5,6-tetrahydropyrimidin-2-ylthio)-N-(2-(trifluoromethyl)phenyl)acetamide

ID: ALA3769594

PubChem CID: 127027484

Max Phase: Preclinical

Molecular Formula: C21H20F3N3O4S2

Molecular Weight: 499.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)C2CN=C(SCC(=O)Nc3ccccc3C(F)(F)F)NC2=O)c(C)c1

Standard InChI:  InChI=1S/C21H20F3N3O4S2/c1-12-7-8-16(13(2)9-12)33(30,31)17-10-25-20(27-19(17)29)32-11-18(28)26-15-6-4-3-5-14(15)21(22,23)24/h3-9,17H,10-11H2,1-2H3,(H,26,28)(H,25,27,29)

Standard InChI Key:  XOPFQYDVMAQHLG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0388    3.6015    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0394    3.6005    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0006    4.2008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8969   -0.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4990    0.7409    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8003    1.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0994    0.7387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3984    1.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3985    2.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0995    3.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8004    2.9887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4377    0.8886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6983    3.7390    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9985    2.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9994    1.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2989    0.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5975    1.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5965    2.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2971    3.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.9605    0.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.6371    0.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6979    4.9390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6590    4.3389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  3  7  1  0
  4 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 21  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 18 22  2  0
 19 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 25 30  1  0
 27 31  1  0
 23 32  2  0
 23 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3769594

    ---

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.54Molecular Weight (Monoisotopic): 499.0847AlogP: 3.32#Rotatable Bonds: 5
Polar Surface Area: 104.70Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.51CX Basic pKa: 3.93CX LogP: 4.09CX LogD: 4.05
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.66Np Likeness Score: -1.67

References

1. Nasiri HR, Linge S, Ullmann D..  (2016)  Thermodynamic profiling of inhibitors of Nrf2:Keap1 interactions.,  26  (2): [PMID:26653613] [10.1016/j.bmcl.2015.11.082]

Source