The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Cyclopropyl-6-fluoro-7-(4-(2-hydroxy-3,5-dinitrobenzoyl)piperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA3769747
PubChem CID: 122387502
Max Phase: Preclinical
Molecular Formula: C24H20FN5O9
Molecular Weight: 541.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cn(C2CC2)c2cc(N3CCN(C(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4O)CC3)c(F)cc2c1=O
Standard InChI: InChI=1S/C24H20FN5O9/c25-17-9-14-18(28(12-1-2-12)11-16(21(14)31)24(34)35)10-19(17)26-3-5-27(6-4-26)23(33)15-7-13(29(36)37)8-20(22(15)32)30(38)39/h7-12,32H,1-6H2,(H,34,35)
Standard InChI Key: XSDDRFBWIFPBGF-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9506 -0.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9141 -2.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8951 2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1953 3.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4931 2.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4907 1.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1905 0.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7956 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0931 2.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3960 3.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6912 2.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6836 1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3808 0.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0856 1.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7997 4.9405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2919 2.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5371 4.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0371 4.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4021 4.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9963 3.7141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0316 3.1074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0045 4.9141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3702 -0.7712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3271 -1.3645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4053 -1.3783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
11 13 1 0
3 11 1 0
4 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
21 28 2 0
18 21 1 0
8 15 1 0
7 29 1 0
1 30 1 0
31 30 1 0
32 31 1 0
30 32 1 0
23 33 1 0
34 35 2 0
34 36 1 0
24 34 1 0
37 38 2 0
37 39 1 0
26 37 1 0
M CHG 4 34 1 36 -1 37 1 39 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.45Molecular Weight (Monoisotopic): 541.1245AlogP: 2.66#Rotatable Bonds: 6Polar Surface Area: 189.36Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.48CX Basic pKa: ┄CX LogP: 3.24CX LogD: -0.18Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.35Np Likeness Score: -1.12
References 1. Sha S, Han H, Gao F, Liu T, Li Z, Xu C, Zhong W, Zhu H. (2015) Discovery of fluoroquinolone derivatives as potent, selective inhibitors of PI3K, 6 (11): [10.1039/C5MD00364D ]