The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Cyclopropyl-6-fluoro-7-(4-(2-hydroxy-5-nitrobenzoyl)piperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA3770035
PubChem CID: 122387505
Max Phase: Preclinical
Molecular Formula: C24H21FN4O7
Molecular Weight: 496.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cn(C2CC2)c2cc(N3CCN(C(=O)c4cc([N+](=O)[O-])ccc4O)CC3)c(F)cc2c1=O
Standard InChI: InChI=1S/C24H21FN4O7/c25-18-10-15-19(28(13-1-2-13)12-17(22(15)31)24(33)34)11-20(18)26-5-7-27(8-6-26)23(32)16-9-14(29(35)36)3-4-21(16)30/h3-4,9-13,30H,1-2,5-8H2,(H,33,34)
Standard InChI Key: JDQJAAYTODKRBI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9506 -0.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9141 -2.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8951 2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1953 3.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4931 2.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4907 1.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1905 0.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7956 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0931 2.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3960 3.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6912 2.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6836 1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3808 0.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0856 1.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7997 4.9405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2919 2.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5371 4.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0371 4.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4021 4.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3702 -0.7712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3271 -1.3645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4053 -1.3783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
11 13 1 0
3 11 1 0
4 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
21 28 2 0
18 21 1 0
8 15 1 0
7 29 1 0
1 30 1 0
31 30 1 0
32 31 1 0
30 32 1 0
23 33 1 0
34 35 2 0
34 36 1 0
26 34 1 0
M CHG 2 34 1 36 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.45Molecular Weight (Monoisotopic): 496.1394AlogP: 2.75#Rotatable Bonds: 5Polar Surface Area: 146.22Molecular Species: ACIDHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.55CX Basic pKa: ┄CX LogP: 3.30CX LogD: 0.31Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: -1.14
References 1. Sha S, Han H, Gao F, Liu T, Li Z, Xu C, Zhong W, Zhu H. (2015) Discovery of fluoroquinolone derivatives as potent, selective inhibitors of PI3K, 6 (11): [10.1039/C5MD00364D ]