The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-(2-Chloronicotinoyl)piperazin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA3770164
PubChem CID: 122387497
Max Phase: Preclinical
Molecular Formula: C22H20ClFN4O4
Molecular Weight: 458.88
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(C(=O)c4cccnc4Cl)CC3)cc21
Standard InChI: InChI=1S/C22H20ClFN4O4/c1-2-26-12-15(22(31)32)19(29)14-10-16(24)18(11-17(14)26)27-6-8-28(9-7-27)21(30)13-4-3-5-25-20(13)23/h3-5,10-12H,2,6-9H2,1H3,(H,31,32)
Standard InChI Key: YFPGPJWFJFJKRB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9506 -0.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9141 -2.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8951 2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1953 3.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4931 2.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4907 1.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1905 0.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7956 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0931 2.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0856 1.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3808 0.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6836 1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6912 2.9730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3960 3.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7997 4.9405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4021 4.9295 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
11 13 1 0
3 11 1 0
4 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
21 28 2 0
18 21 1 0
8 15 1 0
7 29 1 0
30 31 1 0
1 30 1 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.88Molecular Weight (Monoisotopic): 458.1157AlogP: 2.87#Rotatable Bonds: 4Polar Surface Area: 95.74Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.88CX Basic pKa: 0.67CX LogP: 2.52CX LogD: 0.99Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.60Np Likeness Score: -1.49
References 1. Sha S, Han H, Gao F, Liu T, Li Z, Xu C, Zhong W, Zhu H. (2015) Discovery of fluoroquinolone derivatives as potent, selective inhibitors of PI3K, 6 (11): [10.1039/C5MD00364D ]