The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-(2-Chloronicotinoyl)piperazin-1-yl)-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA3770290
PubChem CID: 122387499
Max Phase: Preclinical
Molecular Formula: C23H20ClFN4O4
Molecular Weight: 470.89
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cn(C2CC2)c2cc(N3CCN(C(=O)c4cccnc4Cl)CC3)c(F)cc2c1=O
Standard InChI: InChI=1S/C23H20ClFN4O4/c24-21-14(2-1-5-26-21)22(31)28-8-6-27(7-9-28)19-11-18-15(10-17(19)25)20(30)16(23(32)33)12-29(18)13-3-4-13/h1-2,5,10-13H,3-4,6-9H2,(H,32,33)
Standard InChI Key: XZRGNFBQKATYLE-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9506 -0.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9141 -2.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8951 2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1953 3.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4931 2.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4907 1.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1905 0.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7956 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0931 2.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0856 1.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3808 0.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6836 1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6912 2.9730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3960 3.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7997 4.9405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2919 2.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5371 4.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0371 4.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4021 4.9295 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
11 13 1 0
3 11 1 0
4 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
21 28 2 0
18 21 1 0
8 15 1 0
7 29 1 0
1 30 1 0
31 30 1 0
32 31 1 0
30 32 1 0
27 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.89Molecular Weight (Monoisotopic): 470.1157AlogP: 3.18#Rotatable Bonds: 4Polar Surface Area: 95.74Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.87CX Basic pKa: 0.58CX LogP: 2.62CX LogD: 1.08Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.59Np Likeness Score: -1.30
References 1. Sha S, Han H, Gao F, Liu T, Li Z, Xu C, Zhong W, Zhu H. (2015) Discovery of fluoroquinolone derivatives as potent, selective inhibitors of PI3K, 6 (11): [10.1039/C5MD00364D ]