The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Ethyl-6-fluoro-7-(4-(2-hydroxy-5-methoxybenzoyl)piperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA3770294
PubChem CID: 122387509
Max Phase: Preclinical
Molecular Formula: C24H24FN3O6
Molecular Weight: 469.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(C(=O)c4cc(OC)ccc4O)CC3)cc21
Standard InChI: InChI=1S/C24H24FN3O6/c1-3-26-13-17(24(32)33)22(30)15-11-18(25)20(12-19(15)26)27-6-8-28(9-7-27)23(31)16-10-14(34-2)4-5-21(16)29/h4-5,10-13,29H,3,6-9H2,1-2H3,(H,32,33)
Standard InChI Key: RHZXZKXHSCHVHO-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9506 -0.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9141 -2.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8951 2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1953 3.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4931 2.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4907 1.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1905 0.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7956 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0931 2.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3960 3.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6912 2.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6836 1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3808 0.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0856 1.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7997 4.9405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.4021 4.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3702 -0.7712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3271 -1.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
11 13 1 0
3 11 1 0
4 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
21 28 2 0
18 21 1 0
8 15 1 0
7 29 1 0
23 30 1 0
1 31 1 0
31 32 1 0
33 34 1 0
26 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.47Molecular Weight (Monoisotopic): 469.1649AlogP: 2.54#Rotatable Bonds: 5Polar Surface Area: 112.31Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.88CX Basic pKa: 0.01CX LogP: 3.10CX LogD: 1.54Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.59Np Likeness Score: -0.99
References 1. Sha S, Han H, Gao F, Liu T, Li Z, Xu C, Zhong W, Zhu H. (2015) Discovery of fluoroquinolone derivatives as potent, selective inhibitors of PI3K, 6 (11): [10.1039/C5MD00364D ]