The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 4-(3-((4-fluoro-N-(3-phenoxyphenyl)phenyl)sulfonamido)propanamido)benzoate ID: ALA3770575
PubChem CID: 126695273
Max Phase: Preclinical
Molecular Formula: C30H27FN2O6S
Molecular Weight: 562.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(NC(=O)CCN(c2cccc(Oc3ccccc3)c2)S(=O)(=O)c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C30H27FN2O6S/c1-2-38-30(35)22-11-15-24(16-12-22)32-29(34)19-20-33(40(36,37)28-17-13-23(31)14-18-28)25-7-6-10-27(21-25)39-26-8-4-3-5-9-26/h3-18,21H,2,19-20H2,1H3,(H,32,34)
Standard InChI Key: CBKUCVYNAYIMAL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
-3.6414 3.5980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6013 2.9994 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6398 2.3982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5998 1.4986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8983 0.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8967 -0.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1952 -1.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1936 -3.0082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2352 -0.9088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4921 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4928 -5.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7921 -6.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0909 -5.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0903 -3.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7910 -3.0103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3924 -6.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6908 -5.2544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3950 -7.2071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.9924 -6.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0306 -5.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3028 3.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0025 3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2953 3.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2928 5.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0075 6.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3053 5.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3310 5.8581 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 -5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9073 -5.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9021 -3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
10 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
9 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.62Molecular Weight (Monoisotopic): 562.1574AlogP: 6.02#Rotatable Bonds: 11Polar Surface Area: 102.01Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.37CX Basic pKa: ┄CX LogP: 5.84CX LogD: 5.84Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.22Np Likeness Score: -1.58
References 1. Xie H, Li Y, Bai C, Wang R, Liu C, Hao C, Lin B, Cheng M, Zhao D.. (2016) Discovery of novel N,N-3-phenyl-3-benzylaminopropionanilides as potent inhibitors of cholesteryl ester transfer protein in vivo., 24 (8): [PMID:26993745 ] [10.1016/j.bmc.2016.03.002 ]