The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-(5-Bromo-2-hydroxybenzoyl)piperazin-1-yl)-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA3770822
PubChem CID: 122387504
Max Phase: Preclinical
Molecular Formula: C24H21BrFN3O5
Molecular Weight: 530.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cn(C2CC2)c2cc(N3CCN(C(=O)c4cc(Br)ccc4O)CC3)c(F)cc2c1=O
Standard InChI: InChI=1S/C24H21BrFN3O5/c25-13-1-4-21(30)16(9-13)23(32)28-7-5-27(6-8-28)20-11-19-15(10-18(20)26)22(31)17(24(33)34)12-29(19)14-2-3-14/h1,4,9-12,14,30H,2-3,5-8H2,(H,33,34)
Standard InChI Key: AMHVDPQRVZLYBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9506 -0.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9141 -2.6966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2928 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 1.4990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8951 2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1953 3.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4931 2.9949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4907 1.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1905 0.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7956 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0931 2.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3960 3.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6912 2.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6836 1.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3808 0.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0856 1.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7997 4.9405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2919 2.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5371 4.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0371 4.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4021 4.9295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3748 -0.4704 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
11 13 1 0
3 11 1 0
4 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
21 28 2 0
18 21 1 0
8 15 1 0
7 29 1 0
1 30 1 0
31 30 1 0
32 31 1 0
30 32 1 0
23 33 1 0
26 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.35Molecular Weight (Monoisotopic): 529.0649AlogP: 3.60#Rotatable Bonds: 4Polar Surface Area: 103.08Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.86CX Basic pKa: ┄CX LogP: 4.13CX LogD: 2.43Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.53Np Likeness Score: -0.96
References 1. Sha S, Han H, Gao F, Liu T, Li Z, Xu C, Zhong W, Zhu H. (2015) Discovery of fluoroquinolone derivatives as potent, selective inhibitors of PI3K, 6 (11): [10.1039/C5MD00364D ]