The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(((1r,4r)-4-aminocyclohexyl)methyl)-6-(2-chloro-4-(6-methylpyrazin-2-yl)phenyl)-2-(ethylamino)pyrido[2,3-d]pyrimidin-7(8H)-one ID: ALA3770909
PubChem CID: 90466181
Max Phase: Preclinical
Molecular Formula: C27H30ClN7O
Molecular Weight: 504.04
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCNc1ncc2cc(-c3ccc(-c4cncc(C)n4)cc3Cl)c(=O)n(C[C@H]3CC[C@H](N)CC3)c2n1
Standard InChI: InChI=1S/C27H30ClN7O/c1-3-31-27-32-13-19-10-22(21-9-6-18(11-23(21)28)24-14-30-12-16(2)33-24)26(36)35(25(19)34-27)15-17-4-7-20(29)8-5-17/h6,9-14,17,20H,3-5,7-8,15,29H2,1-2H3,(H,31,32,34)/t17-,20-
Standard InChI Key: PJYRMGKJLXENCU-IRJFHVNHSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 1.4966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 0.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2513 1.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 -1.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4908 -1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4885 -3.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1883 -3.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8904 -2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7870 -3.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0885 -3.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7825 -5.2553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3852 -3.7634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3805 -5.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0792 -6.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0755 -7.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1947 0.4490 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 2.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1985 3.7378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2037 5.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9072 5.9922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6056 5.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2450 5.8341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
7 8 2 0
8 9 1 0
9 10 1 0
3 10 1 0
4 7 1 0
9 11 2 0
13 14 1 0
12 13 1 0
1 12 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
23 26 1 0
26 27 1 0
18 21 1 0
16 28 1 0
8 15 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
30 35 1 0
33 36 1 6
30 29 1 1
10 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.04Molecular Weight (Monoisotopic): 503.2200AlogP: 4.83#Rotatable Bonds: 6Polar Surface Area: 111.61Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.45CX LogP: 3.26CX LogD: 0.52Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -1.08
References 1. Ndubaku CO, Crawford JJ, Drobnick J, Aliagas I, Campbell D, Dong P, Dornan LM, Duron S, Epler J, Gazzard L, Heise CE, Hoeflich KP, Jakubiak D, La H, Lee W, Lin B, Lyssikatos JP, Maksimoska J, Marmorstein R, Murray LJ, O'Brien T, Oh A, Ramaswamy S, Wang W, Zhao X, Zhong Y, Blackwood E, Rudolph J.. (2015) Design of Selective PAK1 Inhibitor G-5555: Improving Properties by Employing an Unorthodox Low-pK a Polar Moiety., 6 (12): [PMID:26713112 ] [10.1021/acsmedchemlett.5b00398 ]