The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-benzyl-1-[(dimethylamino)methyl]-6-methyl-9-phenylpyrazolo[1',5':1,6]pyrimido[4,5-d]pyridazin-4(3H)-one ID: ALA377144
PubChem CID: 11850439
Max Phase: Preclinical
Molecular Formula: C25H24N6O
Molecular Weight: 424.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2c(=O)n(Cc3ccccc3)nc(CN(C)C)c2c2cc(-c3ccccc3)nn12
Standard InChI: InChI=1S/C25H24N6O/c1-17-26-24-23(22-14-20(28-31(17)22)19-12-8-5-9-13-19)21(16-29(2)3)27-30(25(24)32)15-18-10-6-4-7-11-18/h4-14H,15-16H2,1-3H3
Standard InChI Key: NWOYPSQSXFBTCX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
10.8582 -16.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6865 -16.3465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1006 -15.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6927 -14.9208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8629 -14.9169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4441 -15.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8558 -17.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4371 -17.0593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0975 -17.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6847 -17.7707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2348 -18.3829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9862 -18.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9029 -17.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6995 -18.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6938 -19.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4070 -19.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4079 -18.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4431 -18.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1250 -18.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1282 -19.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6187 -15.6277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4545 -14.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8714 -13.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6963 -13.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1131 -12.7853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7046 -12.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8750 -12.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4619 -12.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9259 -15.6386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3416 -14.9256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1669 -14.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9319 -14.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
13 9 2 0
12 14 1 0
14 15 2 0
15 16 1 0
16 20 2 0
19 17 2 0
17 14 1 0
7 18 1 0
19 20 1 0
1 2 2 0
1 6 1 0
6 21 2 0
2 3 1 0
5 22 1 0
3 4 2 0
22 23 1 0
4 5 1 0
23 24 2 0
5 6 1 0
24 25 1 0
7 10 1 0
25 26 2 0
7 8 2 0
26 27 1 0
9 2 1 0
27 28 2 0
28 23 1 0
1 8 1 0
3 29 1 0
9 10 1 0
29 30 1 0
10 11 1 0
30 31 1 0
11 12 2 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.51Molecular Weight (Monoisotopic): 424.2012AlogP: 3.52#Rotatable Bonds: 5Polar Surface Area: 68.32Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.24CX LogP: 3.55CX LogD: 3.32Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.41
References 1. Giovannoni MP, Vergelli C, Biancalani C, Cesari N, Graziano A, Biagini P, Gracia J, Gavaldà A, Dal Piaz V.. (2006) Novel pyrazolopyrimidopyridazinones with potent and selective phosphodiesterase 5 (PDE5) inhibitory activity as potential agents for treatment of erectile dysfunction., 49 (17): [PMID:16913726 ] [10.1021/jm060265+ ]