The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(2-amino-4-hydroxy-8-oxo-6H-pyrrolo[3,4-g]pteridin-7(8H)-yl)benzamido)pentanedioic acid ID: ALA377466
PubChem CID: 135437382
Max Phase: Preclinical
Molecular Formula: C20H17N7O7
Molecular Weight: 467.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(O)c2nc3c(nc2n1)C(=O)N(c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1)C3
Standard InChI: InChI=1S/C20H17N7O7/c21-20-25-15-14(17(31)26-20)22-11-7-27(18(32)13(11)24-15)9-3-1-8(2-4-9)16(30)23-10(19(33)34)5-6-12(28)29/h1-4,10H,5-7H2,(H,23,30)(H,28,29)(H,33,34)(H3,21,24,25,26,31)
Standard InChI Key: KRSGNZLDIIQEHN-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
3.4272 0.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7515 -0.2947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0356 -0.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3215 -0.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3215 0.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0385 0.9427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7530 0.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6101 -0.7081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1040 -0.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1040 0.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6089 0.9417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4643 0.9433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8890 -0.5522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3725 0.1193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8865 0.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1417 1.5681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1975 0.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6121 -0.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4363 -0.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8489 0.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5948 0.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6739 0.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0864 0.8345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0864 -0.5930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9114 -0.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3239 0.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1489 0.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5626 0.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3876 0.8297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1513 1.5462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3233 -1.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9102 -2.0220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1483 -1.3085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0356 -1.5325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 9 2 0
9 10 1 0
10 11 2 0
11 5 1 0
7 12 1 0
9 13 1 0
13 14 1 0
14 15 1 0
15 10 1 0
15 16 2 0
14 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 1 1 0
1 21 2 0
21 17 1 0
20 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
2 3 2 0
27 28 1 0
3 4 1 0
28 29 1 0
4 5 2 0
28 30 2 0
5 6 1 0
25 31 1 0
6 7 2 0
31 32 2 0
7 2 1 0
31 33 1 0
4 8 1 0
3 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.40Molecular Weight (Monoisotopic): 467.1189AlogP: -0.08#Rotatable Bonds: 7Polar Surface Area: 221.82Molecular Species: ACIDHBA: 10HBD: 5#RO5 Violations: ┄HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.12CX Basic pKa: ┄CX LogP: -0.22CX LogD: -6.89Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -0.47
References 1. Dayam R, Aiello F, Deng J, Wu Y, Garofalo A, Chen X, Neamati N.. (2006) Discovery of small molecule integrin alphavbeta3 antagonists as novel anticancer agents., 49 (15): [PMID:16854058 ] [10.1021/jm051296s ]