3-((1R,3R)-3-(4-(6-methoxypyridin-2-yl)-1H-imidazol-2-yl)-1-(1-methyl-1H-pyrazol-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-5-methyl-1,2,4-oxadiazole

ID: ALA3774684

PubChem CID: 127034429

Max Phase: Preclinical

Molecular Formula: C27H25N9O2

Molecular Weight: 507.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2c[nH]c([C@H]3Cc4c([nH]c5ccccc45)[C@](c4cnn(C)c4)(c4noc(C)n4)N3)n2)n1

Standard InChI:  InChI=1S/C27H25N9O2/c1-15-30-26(35-38-15)27(16-12-29-36(2)14-16)24-18(17-7-4-5-8-19(17)32-24)11-21(34-27)25-28-13-22(33-25)20-9-6-10-23(31-20)37-3/h4-10,12-14,21,32,34H,11H2,1-3H3,(H,28,33)/t21-,27-/m1/s1

Standard InChI Key:  MBFARSZGJXRMQQ-JIPXPUAJSA-N

Molfile:  

     RDKit          2D

 38 44  0  0  0  0  0  0  0  0999 V2000
   -3.7006    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7006   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915   -1.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915    1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.3190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2274    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2274   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4732   -1.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7372   -0.6045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7372    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4732    1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0335    1.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1716    3.0613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6389    3.3729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3886    2.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3847    0.9592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8811    1.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8479    3.0569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3236    2.7880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8286    1.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8579    0.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3822    0.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4914   -2.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7702   -2.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8290   -3.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5357   -4.6346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5866   -3.6394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0130   -2.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9389   -3.5098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4123   -3.7910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1350   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1083   -1.3831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7584   -3.8979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3256   -2.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2972    3.9301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4775    3.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  2  0
 12 14  1  6
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 19  1  0
 10 25  1  6
 10 26  1  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 25  2  0
 26 31  2  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 26  1  0
 29 35  1  0
 33 36  1  0
 21 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3774684

    ---

Associated Targets(Human)

SSTR3 Tclin Somatostatin receptor 3 (1562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.56Molecular Weight (Monoisotopic): 507.2131AlogP: 3.57#Rotatable Bonds: 5
Polar Surface Area: 135.36Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.64CX Basic pKa: 2.99CX LogP: 3.45CX LogD: 3.45
Aromatic Rings: 6Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: -0.92

References

1. He S, Dobbelaar PH, Guo L, Ye Z, Liu J, Jian T, Truong Q, Shah SK, Du W, Qi H, Bakshi RK, Hong Q, Dellureficio JD, Sherer E, Pasternak A, Feng Z, Reibarkh M, Lin M, Samuel K, Reddy VB, Mitelman S, Tong SX, Chicchi GG, Tsao KL, Trusca D, Wu M, Shao Q, Trujillo ME, Fernandez G, Nelson D, Bunting P, Kerr J, Fitzgerald P, Morissette P, Volksdorf S, Eiermann GJ, Li C, Zhang BB, Howard AD, Zhou YP, Nargund RP, Hagmann WK..  (2016)  SAR exploration at the C-3 position of tetrahydro-β-carboline sstr3 antagonists.,  26  (6): [PMID:26898814] [10.1016/j.bmcl.2016.02.022]

Source