3-((1S,3R)-3-(4-(5-fluoropyridin-2-yl)-1H-imidazol-2-yl)-1-(1-methyl-1H-pyrazol-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-5-methyl-1,2,4-oxadiazole

ID: ALA3775061

PubChem CID: 127034428

Max Phase: Preclinical

Molecular Formula: C26H22FN9O

Molecular Weight: 495.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc([C@@]2(c3cnn(C)c3)N[C@@H](c3nc(-c4ccc(F)cn4)c[nH]3)Cc3c2[nH]c2ccccc32)no1

Standard InChI:  InChI=1S/C26H22FN9O/c1-14-31-25(35-37-14)26(15-10-30-36(2)13-15)23-18(17-5-3-4-6-19(17)32-23)9-21(34-26)24-29-12-22(33-24)20-8-7-16(27)11-28-20/h3-8,10-13,21,32,34H,9H2,1-2H3,(H,29,33)/t21-,26+/m1/s1

Standard InChI Key:  MQOWSXSGMALBJL-RLWLMLJZSA-N

Molfile:  

     RDKit          2D

 37 43  0  0  0  0  0  0  0  0999 V2000
   -3.7006    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7006   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915   -1.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4915    1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.3190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2274    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2274   -0.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4732   -1.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7372   -0.6045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7372    0.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4732    1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0335    1.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1716    3.0613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6389    3.3729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3886    2.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3847    0.9592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8811    1.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8479    3.0569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3236    2.7880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8286    1.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8579    0.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3822    0.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4914   -2.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7702   -2.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8290   -3.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5357   -4.6346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5866   -3.6394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0130   -2.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9389   -3.5098    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4123   -3.7910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1350   -2.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1083   -1.3831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7584   -3.8979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3256   -2.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0092    1.1604    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  2  0
 12 14  1  6
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 19  1  0
 10 25  1  1
 10 26  1  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 25  2  0
 26 31  2  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 26  1  0
 29 35  1  0
 33 36  1  0
 22 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3775061

    ---

Associated Targets(Human)

SSTR3 Tclin Somatostatin receptor 3 (1562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 495.52Molecular Weight (Monoisotopic): 495.1931AlogP: 3.70#Rotatable Bonds: 4
Polar Surface Area: 126.13Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.79CX Basic pKa: 3.00CX LogP: 3.17CX LogD: 3.17
Aromatic Rings: 6Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -1.01

References

1. He S, Dobbelaar PH, Guo L, Ye Z, Liu J, Jian T, Truong Q, Shah SK, Du W, Qi H, Bakshi RK, Hong Q, Dellureficio JD, Sherer E, Pasternak A, Feng Z, Reibarkh M, Lin M, Samuel K, Reddy VB, Mitelman S, Tong SX, Chicchi GG, Tsao KL, Trusca D, Wu M, Shao Q, Trujillo ME, Fernandez G, Nelson D, Bunting P, Kerr J, Fitzgerald P, Morissette P, Volksdorf S, Eiermann GJ, Li C, Zhang BB, Howard AD, Zhou YP, Nargund RP, Hagmann WK..  (2016)  SAR exploration at the C-3 position of tetrahydro-β-carboline sstr3 antagonists.,  26  (6): [PMID:26898814] [10.1016/j.bmcl.2016.02.022]

Source