7-(2-chlorophenyl)-3-(2-fluorophenyl)-2-((2-methyl-2H-1,2,4-triazol-3-yl)methoxy)pyrazolo[1,5-d][1,2,4]triazine

ID: ALA377533

PubChem CID: 18406869

Max Phase: Preclinical

Molecular Formula: C21H15ClFN7O

Molecular Weight: 435.85

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1ncnc1COc1nn2c(-c3ccccc3Cl)nncc2c1-c1ccccc1F

Standard InChI:  InChI=1S/C21H15ClFN7O/c1-29-18(24-12-26-29)11-31-21-19(14-7-3-5-9-16(14)23)17-10-25-27-20(30(17)28-21)13-6-2-4-8-15(13)22/h2-10,12H,11H2,1H3

Standard InChI Key:  STGQCZPVHDLHAH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -4.4255   -9.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2420   -9.6479    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3592  -10.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6186  -10.8284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0439  -10.2364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2275  -10.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7190   -5.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2879   -6.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2909   -5.2260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0092   -4.8172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0072   -6.4706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7216   -6.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3382   -6.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0049   -7.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1823   -7.2786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4200   -8.0749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0542   -6.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0514   -5.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7664   -4.9633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4806   -5.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4753   -6.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7597   -6.6139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5729   -6.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5743   -7.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8603   -7.7057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1451   -7.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1485   -6.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8631   -6.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0103   -8.7910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7521   -7.4390    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8670   -5.2299    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 15 11  1  0
  2  3  1  0
 14 16  1  0
 11  8  1  0
 13 17  1  0
  3  4  2  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  4  5  1  0
 19 20  2  0
  9 10  1  0
 20 21  1  0
 10  7  2  0
 21 22  2  0
 22 17  1  0
 11 12  1  0
  8 23  1  0
  5  1  1  0
 23 24  2  0
 24 25  1  0
  5  6  1  0
 25 26  2  0
  1  2  2  0
 26 27  1  0
  7 12  1  0
 27 28  2  0
 28 23  1  0
 12 13  2  0
 16 29  1  0
 29  1  1  0
 13 14  1  0
 22 30  1  0
 14 15  2  0
 28 31  1  0
M  END

Associated Targets(Human)

GABRG2 Tclin GABA-A receptor; alpha-3/beta-3/gamma-2 (1250 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GABRA1 Tclin GABA-A receptor; alpha-1/beta-3/gamma-2 (1565 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.85Molecular Weight (Monoisotopic): 435.1011AlogP: 3.96#Rotatable Bonds: 5
Polar Surface Area: 83.02Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.08CX LogP: 3.72CX LogD: 3.72
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -1.76

References

1. Carling RW, Russell MG, Moore KW, Mitchinson A, Guiblin A, Smith A, Wafford KA, Marshall G, Atack JR, Street LJ..  (2006)  2,3,7-Trisubstituted pyrazolo[1,5-d][1,2,4]triazines: functionally selective GABAA alpha3-subtype agonists.,  16  (13): [PMID:16621541] [10.1016/j.bmcl.2006.03.081]

Source