(3R,4S,5S,8S,9S,10S,11R,13R,14S,16S,Z)-17-(1-(3,4-difluorophenylsulfonamido)-6-methyl-1-oxohept-5-en-2-ylidene)-3,11-dihydroxy-4,8,10,14-tetramethylhexadecahydro-1H-cyclopenta[a]phenanthren-16-yl acetate

ID: ALA3775728

PubChem CID: 122387681

Max Phase: Preclinical

Molecular Formula: C37H51F2NO7S

Molecular Weight: 691.88

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]1C[C@@]2(C)[C@@H](C[C@@H](O)[C@H]3[C@@]4(C)CC[C@@H](O)[C@@H](C)[C@@H]4CC[C@@]32C)/C1=C(\CCC=C(C)C)C(=O)NS(=O)(=O)c1ccc(F)c(F)c1

Standard InChI:  InChI=1S/C37H51F2NO7S/c1-20(2)9-8-10-24(34(44)40-48(45,46)23-11-12-27(38)28(39)17-23)32-26-18-30(43)33-35(5)15-14-29(42)21(3)25(35)13-16-36(33,6)37(26,7)19-31(32)47-22(4)41/h9,11-12,17,21,25-26,29-31,33,42-43H,8,10,13-16,18-19H2,1-7H3,(H,40,44)/b32-24-/t21-,25-,26-,29+,30+,31-,33-,35-,36-,37-/m0/s1

Standard InChI Key:  VTUIQVULVGUPIJ-LMENFXEESA-N

Molfile:  

     RDKit          2D

 51 55  0  0  0  0  0  0  0  0999 V2000
   -5.5329    6.4410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4931    7.0400    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4944    5.8400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6359    0.3454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6058   -0.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0878   -0.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6373    1.7871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8973    2.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8461    0.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0893   -1.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1558    1.8028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8964    4.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1543    0.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8629    1.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6029    2.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5890   -1.8069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1952    4.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3493   -2.5695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3646    0.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8308   -2.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4557    2.5537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7562    1.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5895   -1.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2350    4.1881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5881   -0.3966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7952    2.4049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6999    8.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7007    7.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9394   -0.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4357   -0.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1006    0.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9058    2.3833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1943    6.2880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5975    4.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5982    6.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6318   -2.4330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3478   -3.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7570    0.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3392    9.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7390    9.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9820    0.8329    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6361    2.7871    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0849   -2.8226    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4922    8.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1927    9.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1918   10.7901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4904   11.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7899   10.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7908    9.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1522   11.3894    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4897   12.7408    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  9  1  0
  7  4  1  0
  8  7  1  0
  9  5  1  0
 10 20  1  0
 11 13  1  0
 12  8  2  0
 13  4  1  0
 14 15  1  0
 15  7  1  0
 16  5  1  0
 17 12  1  0
 18 10  1  0
 19  6  1  0
 20 16  1  0
 11 21  1  6
 22 21  1  0
 23 18  1  0
 24 17  2  0
 25 19  1  0
 26 22  2  0
 27 28  2  0
 28 35  1  0
  4 29  1  6
  5 30  1  1
  6 31  1  6
 14 32  1  1
 33 17  1  0
 34 12  1  0
 35 34  1  0
 23 36  1  1
 18 37  1  1
 38 22  1  0
 39 27  1  0
 40 27  1  0
  9 41  1  6
  7 42  1  1
 10 43  1  1
 11  8  1  0
 14  9  1  0
  6 10  1  0
 23 25  1  0
 33  2  1  0
  2 44  1  0
 44 45  2  0
 45 46  1  0
 46 47  2  0
 47 48  1  0
 48 49  2  0
 49 44  1  0
 46 50  1  0
 47 51  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3775728

    ---

Associated Targets(non-human)

CHO (4503 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CHO-K1 (1115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 691.88Molecular Weight (Monoisotopic): 691.3354AlogP: 6.36#Rotatable Bonds: 7
Polar Surface Area: 130.00Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 2.31CX Basic pKa: CX LogP: 5.50CX LogD: 4.56
Aromatic Rings: 1Heavy Atoms: 48QED Weighted: 0.17Np Likeness Score: 1.61

References

1. Kaur G, Singh K, Pavadai E, Njoroge M, Espinoza-Moraga M, De Kock C, Smith PJ, Wittlin S, Chibale K.  (2015)  Synthesis of fusidic acid bioisosteres as antiplasmodial agents and molecular docking studies in the binding site of elongation factor-G,  (11): [10.1039/C5MD00343A]
2. Singh K,Kaur G,Shanika PS,Dziwornu GA,Okombo J,Chibale K.  (2020)  Structure-activity relationship analyses of fusidic acid derivatives highlight crucial role of the C-21 carboxylic acid moiety to its anti-mycobacterial activity.,  28  (13): [PMID:32362386] [10.1016/j.bmc.2020.115530]

Source