The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-{[1-(2,4-difluorophenyl)-1H-1,2,3-triazol-4-yl]methoxy}-3-methoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one ID: ALA3780025
PubChem CID: 127033198
Max Phase: Preclinical
Molecular Formula: C27H21F2N3O6
Molecular Weight: 521.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c2c(=O)cc(-c3ccc(OCc4cn(-c5ccc(F)cc5F)nn4)c(OC)c3)oc2c1
Standard InChI: InChI=1S/C27H21F2N3O6/c1-34-18-10-25(36-3)27-21(33)12-23(38-26(27)11-18)15-4-7-22(24(8-15)35-2)37-14-17-13-32(31-30-17)20-6-5-16(28)9-19(20)29/h4-13H,14H2,1-3H3
Standard InChI Key: ZEURTRLLPADFPA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 -1.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4908 -1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4885 -3.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1883 -3.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8904 -2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1830 -5.2518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1420 -5.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7886 -3.7527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0885 -3.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3886 -3.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7410 -3.1331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7430 -4.2493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9910 -5.5472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5243 -5.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5993 -6.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6224 -8.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1255 -9.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6009 -9.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5731 -8.6013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0700 -7.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0034 -10.8741 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.8475 -6.2741 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
4 12 1 0
12 13 1 0
2 14 1 0
14 15 1 0
8 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 26 2 0
29 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
36 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.48Molecular Weight (Monoisotopic): 521.1398AlogP: 4.92#Rotatable Bonds: 8Polar Surface Area: 97.84Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.13CX LogD: 4.13Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: -0.68
References 1. Kant R, Kumar D, Agarwal D, Gupta RD, Tilak R, Awasthi SK, Agarwal A.. (2016) Synthesis of newer 1,2,3-triazole linked chalcone and flavone hybrid compounds and evaluation of their antimicrobial and cytotoxic activities., 113 [PMID:26922227 ] [10.1016/j.ejmech.2016.02.041 ]