The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-((4-(3-(3-(tert-Butyl)-1-(p-tolyl)-1H-pyrazol-5-yl)ureido)-naphthalen-1-yl)oxy)ethyl)-N-methylpicolinamide ID: ALA3780089
PubChem CID: 127030772
Max Phase: Preclinical
Molecular Formula: C34H36N6O3
Molecular Weight: 576.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1cc(CCOc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)cc3)c3ccccc23)ccn1
Standard InChI: InChI=1S/C34H36N6O3/c1-22-10-12-24(13-11-22)40-31(21-30(39-40)34(2,3)4)38-33(42)37-27-14-15-29(26-9-7-6-8-25(26)27)43-19-17-23-16-18-36-28(20-23)32(41)35-5/h6-16,18,20-21H,17,19H2,1-5H3,(H,35,41)(H2,37,38,42)
Standard InChI Key: LSTJDRAIGHTXFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
-5.1711 8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8739 7.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1785 5.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4757 6.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4720 7.5180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1704 9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1308 10.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4694 10.5174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4689 11.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6288 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 -5.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0118 -7.4927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4782 -7.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2314 -6.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2305 -5.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 -6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8881 -8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 -8.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8122 -10.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3087 -9.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3969 -9.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2681 -11.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0203 -11.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7218 -6.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4254 -7.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2123 -5.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9155 -6.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
11 12 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
14 23 2 0
18 23 1 0
24 25 1 0
25 26 2 0
25 27 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
28 32 1 0
33 34 1 0
33 36 2 0
34 37 2 0
35 37 1 0
35 38 2 0
36 38 1 0
35 39 1 0
28 33 1 0
30 40 1 0
27 32 1 0
17 24 1 0
13 14 1 0
12 13 1 0
3 11 1 0
40 41 1 0
40 42 1 0
40 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 576.70Molecular Weight (Monoisotopic): 576.2849AlogP: 6.65#Rotatable Bonds: 8Polar Surface Area: 110.17Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.32CX Basic pKa: 2.62CX LogP: 6.83CX LogD: 6.83Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.19Np Likeness Score: -1.41
References 1. Onions ST, Ito K, Charron CE, Brown RJ, Colucci M, Frickel F, Hardy G, Joly K, King-Underwood J, Kizawa Y, Knowles I, Murray PJ, Novak A, Rani A, Rapeport G, Smith A, Strong P, Taddei DM, Williams JG.. (2016) Discovery of Narrow Spectrum Kinase Inhibitors: New Therapeutic Agents for the Treatment of COPD and Steroid-Resistant Asthma., 59 (5): [PMID:26800309 ] [10.1021/acs.jmedchem.5b01029 ]