The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E)-3-[3,4-bis({[1-(2-chlorophenyl)-1H-1,2,3-triazol-4-yl]methoxy})phenyl]-1-(2-hydroxy-4,6-dimethoxyphenyl)prop-2-en-1-one ID: ALA3780286
PubChem CID: 127032880
Max Phase: Preclinical
Molecular Formula: C35H28Cl2N6O6
Molecular Weight: 699.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c(C(=O)/C=C/c2ccc(OCc3cn(-c4ccccc4Cl)nn3)c(OCc3cn(-c4ccccc4Cl)nn3)c2)c(OC)c1
Standard InChI: InChI=1S/C35H28Cl2N6O6/c1-46-25-16-31(45)35(34(17-25)47-2)30(44)13-11-22-12-14-32(48-20-23-18-42(40-38-23)28-9-5-3-7-26(28)36)33(15-22)49-21-24-19-43(41-39-24)29-10-6-4-8-27(29)37/h3-19,45H,20-21H2,1-2H3/b13-11+
Standard InChI Key: NBHQQDLCZIYBHV-ACCUITESSA-N
Molfile:
RDKit 2D
49 54 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 -3.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1876 -6.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1824 -7.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8808 -8.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5843 -7.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5895 -6.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2804 -8.2467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8786 -9.7587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1769 -10.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1748 -12.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3853 -12.8766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9168 -14.3016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.4168 -14.2964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9582 -12.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5305 -15.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0549 -15.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0805 -16.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5808 -17.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0557 -18.0570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0301 -16.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0156 -7.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3195 -8.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6687 -7.6074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6763 -8.7187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9308 -10.0203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4625 -9.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5460 -11.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0179 -11.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5281 -13.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5615 -14.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0849 -13.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5747 -12.5345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7908 -10.7330 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.2100 -17.1352 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
2 9 1 0
9 10 1 0
4 11 1 0
5 12 1 0
12 13 1 0
12 14 2 0
13 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
19 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
29 25 2 0
28 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
22 36 1 0
36 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 1 0
41 37 2 0
40 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 42 1 0
43 48 1 0
35 49 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 699.55Molecular Weight (Monoisotopic): 698.1447AlogP: 6.93#Rotatable Bonds: 13Polar Surface Area: 135.64Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.19CX Basic pKa: ┄CX LogP: 7.84CX LogD: 7.42Aromatic Rings: 6Heavy Atoms: 49QED Weighted: 0.10Np Likeness Score: -0.46
References 1. Kant R, Kumar D, Agarwal D, Gupta RD, Tilak R, Awasthi SK, Agarwal A.. (2016) Synthesis of newer 1,2,3-triazole linked chalcone and flavone hybrid compounds and evaluation of their antimicrobial and cytotoxic activities., 113 [PMID:26922227 ] [10.1016/j.ejmech.2016.02.041 ]