The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-{[1-(4-chlorophenyl)-1H-1,2,3-triazol-4-yl]methoxy}-3-methoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one ID: ALA3780383
PubChem CID: 127032885
Max Phase: Preclinical
Molecular Formula: C27H22ClN3O6
Molecular Weight: 519.94
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c2c(=O)cc(-c3ccc(OCc4cn(-c5ccc(Cl)cc5)nn4)c(OC)c3)oc2c1
Standard InChI: InChI=1S/C27H22ClN3O6/c1-33-20-11-25(35-3)27-21(32)13-23(37-26(27)12-20)16-4-9-22(24(10-16)34-2)36-15-18-14-31(30-29-18)19-7-5-17(28)6-8-19/h4-14H,15H2,1-3H3
Standard InChI Key: TVVONPRCYVDYLL-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 -1.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -0.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4908 -1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4885 -3.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1883 -3.7510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8904 -2.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1830 -5.2518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1420 -5.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7886 -3.7527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0885 -3.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3886 -3.7521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7410 -3.1331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7430 -4.2493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9910 -5.5472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5243 -5.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5993 -6.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0700 -7.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5731 -8.6013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6009 -9.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1255 -9.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6224 -8.0597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0034 -10.8741 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
4 12 1 0
12 13 1 0
2 14 1 0
14 15 1 0
8 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 26 2 0
29 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.94Molecular Weight (Monoisotopic): 519.1197AlogP: 5.30#Rotatable Bonds: 8Polar Surface Area: 97.84Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.45CX LogD: 4.45Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.61
References 1. Kant R, Kumar D, Agarwal D, Gupta RD, Tilak R, Awasthi SK, Agarwal A.. (2016) Synthesis of newer 1,2,3-triazole linked chalcone and flavone hybrid compounds and evaluation of their antimicrobial and cytotoxic activities., 113 [PMID:26922227 ] [10.1016/j.ejmech.2016.02.041 ]