The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(((4-(3-(3-(tert-Butyl)-1-(p-tolyl)-1H-pyrazol-5-yl)ureido)-naphthalen-1-yl)oxy)methyl)-N-(2-methoxyethyl)picolinamide ID: ALA3780410
PubChem CID: 127031107
Max Phase: Preclinical
Molecular Formula: C35H38N6O4
Molecular Weight: 606.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCNC(=O)c1cc(COc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)cc3)c3ccccc23)ccn1
Standard InChI: InChI=1S/C35H38N6O4/c1-23-10-12-25(13-11-23)41-32(21-31(40-41)35(2,3)4)39-34(43)38-28-14-15-30(27-9-7-6-8-26(27)28)45-22-24-16-17-36-29(20-24)33(42)37-18-19-44-5/h6-17,20-21H,18-19,22H2,1-5H3,(H,37,42)(H2,38,39,43)
Standard InChI Key: RIXGUEXIIVCQKG-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
-3.8669 7.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8757 6.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2777 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2688 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5634 8.2553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1606 8.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2044 7.6817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1496 9.7745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4433 10.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4323 12.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7260 12.7968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7172 13.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6288 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 -5.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0118 -7.4927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4782 -7.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2314 -6.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2305 -5.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 -6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8881 -8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 -8.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8122 -10.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3087 -9.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3969 -9.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2681 -11.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0203 -11.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7218 -6.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4254 -7.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2123 -5.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9155 -6.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
7 8 2 0
7 9 1 0
10 11 1 0
12 13 1 0
11 12 1 0
9 10 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
16 25 2 0
20 25 1 0
26 27 1 0
27 28 2 0
27 29 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
30 34 1 0
35 36 1 0
35 38 2 0
36 39 2 0
37 39 1 0
37 40 2 0
38 40 1 0
37 41 1 0
30 35 1 0
32 42 1 0
29 34 1 0
19 26 1 0
15 16 1 0
14 15 1 0
3 14 1 0
42 43 1 0
42 44 1 0
42 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 606.73Molecular Weight (Monoisotopic): 606.2955AlogP: 6.63#Rotatable Bonds: 10Polar Surface Area: 119.40Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.32CX Basic pKa: 2.26CX LogP: 6.49CX LogD: 6.49Aromatic Rings: 5Heavy Atoms: 45QED Weighted: 0.15Np Likeness Score: -1.61
References 1. Onions ST, Ito K, Charron CE, Brown RJ, Colucci M, Frickel F, Hardy G, Joly K, King-Underwood J, Kizawa Y, Knowles I, Murray PJ, Novak A, Rani A, Rapeport G, Smith A, Strong P, Taddei DM, Williams JG.. (2016) Discovery of Narrow Spectrum Kinase Inhibitors: New Therapeutic Agents for the Treatment of COPD and Steroid-Resistant Asthma., 59 (5): [PMID:26800309 ] [10.1021/acs.jmedchem.5b01029 ]