The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-((4-(3-(3-(tert-Butyl)-1-(p-tolyl)-1H-pyrazol-5-yl)ureido)-naphthalen-1-yl)oxy)ethyl)-N-(2-methoxyethyl)picolinamide ID: ALA3780629
PubChem CID: 127031414
Max Phase: Preclinical
Molecular Formula: C36H40N6O4
Molecular Weight: 620.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCNC(=O)c1cc(CCOc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)cc3)c3ccccc23)ccn1
Standard InChI: InChI=1S/C36H40N6O4/c1-24-10-12-26(13-11-24)42-33(23-32(41-42)36(2,3)4)40-35(44)39-29-14-15-31(28-9-7-6-8-27(28)29)46-20-17-25-16-18-37-30(22-25)34(43)38-19-21-45-5/h6-16,18,22-23H,17,19-21H2,1-5H3,(H,38,43)(H2,39,40,44)
Standard InChI Key: LYCKQJNDNWHGJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 50 0 0 0 0 0 0 0 0999 V2000
-5.1711 8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8739 7.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1785 5.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4757 6.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4720 7.5180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1704 9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1308 10.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4694 10.5174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4688 12.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7677 12.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7671 14.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.8057 14.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6288 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 -5.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0118 -7.4927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4782 -7.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2314 -6.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2305 -5.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 -6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8881 -8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 -8.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8122 -10.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3087 -9.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3969 -9.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2681 -11.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0203 -11.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7218 -6.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4254 -7.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2123 -5.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9155 -6.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
7 8 2 0
7 9 1 0
10 11 1 0
12 13 1 0
11 12 1 0
9 10 1 0
14 15 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
17 26 2 0
21 26 1 0
27 28 1 0
28 29 2 0
28 30 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
31 35 1 0
36 37 1 0
36 39 2 0
37 40 2 0
38 40 1 0
38 41 2 0
39 41 1 0
38 42 1 0
31 36 1 0
33 43 1 0
30 35 1 0
20 27 1 0
16 17 1 0
15 16 1 0
3 14 1 0
43 44 1 0
43 45 1 0
43 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 620.75Molecular Weight (Monoisotopic): 620.3111AlogP: 6.67#Rotatable Bonds: 11Polar Surface Area: 119.40Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.32CX Basic pKa: 2.61CX LogP: 6.78CX LogD: 6.78Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.14Np Likeness Score: -1.50
References 1. Onions ST, Ito K, Charron CE, Brown RJ, Colucci M, Frickel F, Hardy G, Joly K, King-Underwood J, Kizawa Y, Knowles I, Murray PJ, Novak A, Rani A, Rapeport G, Smith A, Strong P, Taddei DM, Williams JG.. (2016) Discovery of Narrow Spectrum Kinase Inhibitors: New Therapeutic Agents for the Treatment of COPD and Steroid-Resistant Asthma., 59 (5): [PMID:26800309 ] [10.1021/acs.jmedchem.5b01029 ]