N-(2-(((4-ethoxyphenyl)amino)methyl)-1,3-dioxoisoindolin-4-yl)benzamide

ID: ALA3781355

PubChem CID: 127030142

Max Phase: Preclinical

Molecular Formula: C24H21N3O4

Molecular Weight: 415.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1ccc(NCN2C(=O)c3cccc(NC(=O)c4ccccc4)c3C2=O)cc1

Standard InChI:  InChI=1S/C24H21N3O4/c1-2-31-18-13-11-17(12-14-18)25-15-27-23(29)19-9-6-10-20(21(19)24(27)30)26-22(28)16-7-4-3-5-8-16/h3-14,25H,2,15H2,1H3,(H,26,28)

Standard InChI Key:  YGBAJMXMFYOQJJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -2.2935    3.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2878    5.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5824    6.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5736    7.5284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2702    8.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9756    7.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9844    6.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3352    3.1743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971    3.0138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0825    2.3453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8208    1.3475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3215    1.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0567    2.6752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5566    2.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3214    1.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5863    0.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0864    0.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8222    1.4161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5856    0.1239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7855    0.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 10 18  1  0
 13 18  2  0
 12 19  2  0
 10 20  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 30 31  1  0
 29 30  1  0
 26 29  1  0
 22 23  1  0
 21 22  1  0
 11 21  1  0
  9 14  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3781355

    ---

Associated Targets(Human)

RPS6KA2 Tchem Ribosomal protein S6 kinase alpha 2 (2184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.45Molecular Weight (Monoisotopic): 415.1532AlogP: 4.00#Rotatable Bonds: 7
Polar Surface Area: 87.74Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.83CX LogP: 4.24CX LogD: 4.24
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: -1.37

References

1. Zhou W, Li S, Lu W, Yuan J, Xu Y, Li H, Huang J, Zhao Z.  (2016)  Isoindole-1,3-dione derivatives as RSK2 inhibitors: synthesis, molecular docking simulation and SAR analysis,  (2): [10.1039/C5MD00469A]

Source