The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(((4-(3-(3-(tert-Butyl)-1-(p-tolyl)-1H-pyrazol-5-yl)ureido)-naphthalen-1-yl)oxy)methyl)-N-(2-morpholinoethyl)-picolinamide ID: ALA3781413
PubChem CID: 127031108
Max Phase: Preclinical
Molecular Formula: C38H43N7O4
Molecular Weight: 661.81
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(OCc3ccnc(C(=O)NCCN4CCOCC4)c3)c3ccccc23)cc1
Standard InChI: InChI=1S/C38H43N7O4/c1-26-9-11-28(12-10-26)45-35(24-34(43-45)38(2,3)4)42-37(47)41-31-13-14-33(30-8-6-5-7-29(30)31)49-25-27-15-16-39-32(23-27)36(46)40-17-18-44-19-21-48-22-20-44/h5-16,23-24H,17-22,25H2,1-4H3,(H,40,46)(H2,41,42,47)
Standard InChI Key: HNTBYCLQOJUQFT-UHFFFAOYSA-N
Molfile:
RDKit 2D
49 54 0 0 0 0 0 0 0 0999 V2000
-3.8669 7.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8757 6.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2777 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2688 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5634 8.2553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1606 8.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2044 7.6817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1496 9.7745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4433 10.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4323 12.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3152 14.3123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.0117 15.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7172 14.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7260 12.7968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0296 12.0546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3241 12.8123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6288 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 -5.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0118 -7.4927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4782 -7.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2314 -6.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2305 -5.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 -6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8881 -8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 -8.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8122 -10.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3087 -9.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3969 -9.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2681 -11.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0203 -11.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7218 -6.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4254 -7.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2123 -5.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9155 -6.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
7 8 2 0
7 9 1 0
10 11 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
12 17 1 0
11 15 1 0
9 10 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
20 29 2 0
24 29 1 0
30 31 1 0
31 32 2 0
31 33 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
34 38 1 0
39 40 1 0
39 42 2 0
40 43 2 0
41 43 1 0
41 44 2 0
42 44 1 0
41 45 1 0
34 39 1 0
36 46 1 0
33 38 1 0
23 30 1 0
19 20 1 0
18 19 1 0
3 18 1 0
46 47 1 0
46 48 1 0
46 49 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 661.81Molecular Weight (Monoisotopic): 661.3377AlogP: 6.31#Rotatable Bonds: 10Polar Surface Area: 122.64Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.32CX Basic pKa: 5.86CX LogP: 6.34CX LogD: 6.32Aromatic Rings: 5Heavy Atoms: 49QED Weighted: 0.16Np Likeness Score: -1.73
References 1. Onions ST, Ito K, Charron CE, Brown RJ, Colucci M, Frickel F, Hardy G, Joly K, King-Underwood J, Kizawa Y, Knowles I, Murray PJ, Novak A, Rani A, Rapeport G, Smith A, Strong P, Taddei DM, Williams JG.. (2016) Discovery of Narrow Spectrum Kinase Inhibitors: New Therapeutic Agents for the Treatment of COPD and Steroid-Resistant Asthma., 59 (5): [PMID:26800309 ] [10.1021/acs.jmedchem.5b01029 ]