The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(3,5-bis(3-chlorophenyl)-4,5-dihydroisoxazole-4-carbonyl)-2-hydroxybenzoic acid ID: ALA3781520
PubChem CID: 127031077
Max Phase: Preclinical
Molecular Formula: C23H15Cl2NO5
Molecular Weight: 456.28
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc(C(=O)C2C(c3cccc(Cl)c3)=NOC2c2cccc(Cl)c2)ccc1O
Standard InChI: InChI=1S/C23H15Cl2NO5/c24-15-5-1-3-12(9-15)20-19(22(31-26-20)14-4-2-6-16(25)10-14)21(28)13-7-8-18(27)17(11-13)23(29)30/h1-11,19,22,27H,(H,29,30)
Standard InChI Key: JTILGYSBVZXOBY-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
4.2010 -3.2956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2567 0.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3615 1.3842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6819 1.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9901 2.5237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4154 2.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5328 1.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2247 0.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7994 0.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7206 4.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8256 5.2598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8602 4.8362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6731 2.3640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4458 -1.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1563 -0.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6557 -0.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4415 -1.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7280 -3.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2285 -3.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3566 -4.1053 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 2 0
3 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
4 12 1 0
12 13 2 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
16 20 1 0
20 21 2 0
20 22 1 0
17 23 1 0
5 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
8 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.28Molecular Weight (Monoisotopic): 455.0327AlogP: 5.37#Rotatable Bonds: 5Polar Surface Area: 96.19Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.65CX Basic pKa: 1.57CX LogP: 6.10CX LogD: 2.84Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -0.20
References 1. Puttaswamy N, Pavan Kumar GS, Al-Ghorbani M, Vigneshwaran V, Prabhakar BT, Khanum SA.. (2016) Synthesis and biological evaluation of salicylic acid conjugated isoxazoline analogues on immune cell proliferation and angiogenesis., 114 [PMID:26974382 ] [10.1016/j.ejmech.2016.02.052 ]