The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(tert-Butyl)-1-(p-tolyl)-1H-pyrazol-5-yl)-3-(4-((2-(3-methylureido)pyridin-4-yl)ethoxy)naphthalen-1-yl)urea ID: ALA3781687
PubChem CID: 45254577
Max Phase: Preclinical
Molecular Formula: C34H37N7O3
Molecular Weight: 591.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)Nc1cc(CCOc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)cc3)c3ccccc23)ccn1
Standard InChI: InChI=1S/C34H37N7O3/c1-22-10-12-24(13-11-22)41-31(21-29(40-41)34(2,3)4)39-33(43)37-27-14-15-28(26-9-7-6-8-25(26)27)44-19-17-23-16-18-36-30(20-23)38-32(42)35-5/h6-16,18,20-21H,17,19H2,1-5H3,(H2,37,39,43)(H2,35,36,38,42)
Standard InChI Key: ATSRNUWJDQUCNU-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
-2.5812 5.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6288 3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 -5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1711 -8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8739 -7.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 -6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1785 -5.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4757 -6.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4720 -7.5180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1704 -9.7656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4694 -10.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5091 -9.9182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4688 -12.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.5073 -12.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0118 7.4927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.4782 7.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2314 6.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2305 5.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8881 8.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4375 8.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8122 10.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3087 9.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3969 9.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2681 11.0095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0203 11.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7218 6.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4254 7.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2123 5.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9155 6.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
5 14 2 0
9 14 1 0
16 17 1 0
15 16 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
18 23 2 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
18 24 1 0
17 20 1 0
8 15 1 0
4 5 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
29 33 1 0
34 35 1 0
34 37 2 0
35 38 2 0
36 38 1 0
36 39 2 0
37 39 1 0
36 40 1 0
29 34 1 0
31 41 1 0
1 33 1 0
41 42 1 0
41 43 1 0
41 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 591.72Molecular Weight (Monoisotopic): 591.2958AlogP: 7.04#Rotatable Bonds: 8Polar Surface Area: 122.20Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.21CX Basic pKa: 4.27CX LogP: 7.09CX LogD: 7.09Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.15Np Likeness Score: -1.39
References 1. Onions ST, Ito K, Charron CE, Brown RJ, Colucci M, Frickel F, Hardy G, Joly K, King-Underwood J, Kizawa Y, Knowles I, Murray PJ, Novak A, Rani A, Rapeport G, Smith A, Strong P, Taddei DM, Williams JG.. (2016) Discovery of Narrow Spectrum Kinase Inhibitors: New Therapeutic Agents for the Treatment of COPD and Steroid-Resistant Asthma., 59 (5): [PMID:26800309 ] [10.1021/acs.jmedchem.5b01029 ]