The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
imperialine beta-N-oxide ID: ALA3785338
PubChem CID: 16397295
Max Phase: Preclinical
Molecular Formula: C27H43NO4
Molecular Weight: 445.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1CC[C@H]2[C@@](C)(O)[C@@H]3CC[C@@H]4[C@@H](C[C@H]5[C@H]4CC(=O)[C@H]4C[C@@H](O)CC[C@@]45C)[C@@H]3C[N+]2([O-])C1
Standard InChI: InChI=1S/C27H43NO4/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25,32)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-23,25,29,31H,4-14H2,1-3H3/t15-,16-,17+,18+,19-,20-,21+,22-,23+,25-,26+,27-,28?/m0/s1
Standard InChI Key: RTQDXHMAHWNJLQ-QCCAPMPZSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
-6.4896 -4.6894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4500 -2.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4500 -4.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1200 -4.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1200 -1.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7800 -2.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7800 -4.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4500 -4.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1200 -4.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4300 -1.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1000 -2.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1200 -0.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3500 -0.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0200 -1.5300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5400 -1.6700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4100 -0.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2300 1.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7700 1.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6400 2.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5400 2.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4100 3.8200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9700 3.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8000 4.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1100 6.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5900 6.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7200 5.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7713 -1.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4500 -6.0600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7816 -5.0900 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.2340 -1.2553 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.8177 -3.0073 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.3513 -2.4735 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.1596 0.7104 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2330 1.1872 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.7668 0.9301 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.2953 3.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0493 1.3776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9675 3.6392 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.0641 7.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2126 3.8991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 5 1 0
3 4 1 0
4 7 1 0
6 5 1 0
6 7 1 0
6 10 1 0
7 8 1 0
8 9 1 0
9 11 1 0
10 11 1 0
11 14 1 0
13 12 1 0
12 10 1 0
13 14 1 0
13 17 1 0
14 15 1 0
15 16 1 0
16 18 1 0
17 18 1 0
17 20 1 0
18 19 1 0
19 22 1 0
21 20 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
6 27 1 1
8 28 2 0
7 29 1 6
10 30 1 6
11 31 1 1
14 32 1 6
13 33 1 6
17 34 1 1
18 35 1 1
3 1 1 1
19 36 1 6
19 37 1 0
22 38 1 6
25 39 1 1
21 40 1 0
M CHG 2 21 1 40 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.64Molecular Weight (Monoisotopic): 445.3192AlogP: 3.90#Rotatable Bonds: ┄Polar Surface Area: 80.59Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.97CX Basic pKa: 3.43CX LogP: 2.10CX LogD: 2.10Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: 2.94
References 1. Li Y, Yili A, Li J, Muhamat A, Aisa HA.. (2016) New isosteroidal alkaloids with tracheal relaxant effect from the bulbs of Fritillaria pallidiflora Schrenk., 26 (8): [PMID:26965859 ] [10.1016/j.bmcl.2016.03.001 ]