(rac)-5-Methoxy-2-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-inden-1-one

ID: ALA3785594

PubChem CID: 58027362

Max Phase: Preclinical

Molecular Formula: C23H20O3

Molecular Weight: 344.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(C2C(=O)c3ccc(OC)cc3C2c2ccccc2)cc1

Standard InChI:  InChI=1S/C23H20O3/c1-25-17-10-8-16(9-11-17)22-21(15-6-4-3-5-7-15)20-14-18(26-2)12-13-19(20)23(22)24/h3-14,21-22H,1-2H3

Standard InChI Key:  RFAZNDRBXSBRNO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0896    0.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1749    2.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2517    3.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8114    5.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6621    2.8384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9234    1.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4199    1.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0791   -0.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2418   -1.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7453   -1.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2218    4.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2965    5.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187    1.4919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6251    2.6919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5761   -0.2862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1020   -1.3649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  7 10  2  0
  8 11  1  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 22  2  0
 21 15  2  0
 15 12  1  0
 11 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 11  1  0
 21 22  1  0
  1 23  1  0
 23 24  1  0
 18 25  1  0
 25 26  1  0
M  END

Associated Targets(non-human)

RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rela Transcription factor p65 (175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mapk14 MAP kinase p38 (226 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.41Molecular Weight (Monoisotopic): 344.1412AlogP: 4.82#Rotatable Bonds: 4
Polar Surface Area: 35.53Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.62CX LogD: 4.62
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.68Np Likeness Score: 0.33

References

1. Tang ML, Zhong C, Liu ZY, Peng P, Liu XH, Sun X..  (2016)  Discovery of novel sesquistilbene indanone analogues as potent anti-inflammatory agents.,  113  [PMID:26922229] [10.1016/j.ejmech.2016.02.021]
2. Tang ML, Zhong C, Liu ZY, Peng P, Liu XH, Sun X..  (2016)  Discovery of novel sesquistilbene indanone analogues as potent anti-inflammatory agents.,  113  [PMID:26922229] [10.1016/j.ejmech.2016.02.021]
3. Tang ML, Zhong C, Liu ZY, Peng P, Liu XH, Sun X..  (2016)  Discovery of novel sesquistilbene indanone analogues as potent anti-inflammatory agents.,  113  [PMID:26922229] [10.1016/j.ejmech.2016.02.021]

Source