The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+/-)-4-Nitrophenyl-4-((trans-2-(benzo[d][1,3]dioxol-5-yl)-3-(4-fluorophenyl)-4-oxoazetidin-1-yl)piperidine-1-carboxylate ID: ALA3785760
PubChem CID: 127030392
Max Phase: Preclinical
Molecular Formula: C28H24FN3O7
Molecular Weight: 533.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Oc1ccc([N+](=O)[O-])cc1)N1CCC(N2C(=O)[C@H](c3ccc(F)cc3)[C@H]2c2ccc3c(c2)OCO3)CC1
Standard InChI: InChI=1S/C28H24FN3O7/c29-19-4-1-17(2-5-19)25-26(18-3-10-23-24(15-18)38-16-37-23)31(27(25)33)20-11-13-30(14-12-20)28(34)39-22-8-6-21(7-9-22)32(35)36/h1-10,15,20,25-26H,11-14,16H2/t25-,26-/m1/s1
Standard InChI Key: CQUBMTHPOONKSG-CLJLJLNGSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-3.9638 2.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4118 2.5255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0201 1.0775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2004 4.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7374 4.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2375 5.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2124 7.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6871 6.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1870 5.3460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7510 -0.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2474 -1.6332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2167 -2.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6928 -2.5108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.1995 -1.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2301 0.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4524 3.1230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8125 8.1659 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-8.6650 -3.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2616 -4.7843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.1415 -3.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.1137 -4.5282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.5898 -4.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.5591 -5.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0525 -6.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5764 -7.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.6071 -5.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0200 -7.9650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.6131 -9.0939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-15.2012 -7.7533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
5 6 2 0
6 23 1 0
22 7 1 0
7 8 2 0
8 5 1 0
4 5 1 1
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
1 9 1 6
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
3 15 1 0
2 21 2 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 22 1 0
12 27 1 0
18 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
37 38 2 0
37 39 1 0
34 37 1 0
M CHG 2 37 1 39 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.51Molecular Weight (Monoisotopic): 533.1598AlogP: 4.79#Rotatable Bonds: 5Polar Surface Area: 111.45Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.05CX LogD: 4.05Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -0.78
References 1. Brindisi M, Maramai S, Gemma S, Brogi S, Grillo A, Di Cesare Mannelli L, Gabellieri E, Lamponi S, Saponara S, Gorelli B, Tedesco D, Bonfiglio T, Landry C, Jung KM, Armirotti A, Luongo L, Ligresti A, Piscitelli F, Bertucci C, Dehouck MP, Campiani G, Maione S, Ghelardini C, Pittaluga A, Piomelli D, Di Marzo V, Butini S.. (2016) Development and Pharmacological Characterization of Selective Blockers of 2-Arachidonoyl Glycerol Degradation with Efficacy in Rodent Models of Multiple Sclerosis and Pain., 59 (6): [PMID:26888301 ] [10.1021/acs.jmedchem.5b01812 ]