22,26-imino-17,23-oxido-5alpha-jerv-6-oxo-3beta,14beta-diol-12alpha,13alpha-epoxy

ID: ALA3786249

PubChem CID: 127031861

Max Phase: Preclinical

Molecular Formula: C27H41NO5

Molecular Weight: 459.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1CN[C@H]2[C@@H](C)[C@@]3(CC[C@]4(O)[C@@H]5CC(=O)[C@H]6C[C@@H](O)CC[C@]6(C)[C@H]5C[C@]45O[C@]53C)O[C@@H]2C1

Standard InChI:  InChI=1S/C27H41NO5/c1-14-9-21-22(28-13-14)15(2)26(32-21)8-7-25(31)17-11-20(30)18-10-16(29)5-6-23(18,3)19(17)12-27(25)24(26,4)33-27/h14-19,21-22,28-29,31H,5-13H2,1-4H3/t14-,15+,16-,17+,18+,19-,21+,22-,23-,24-,25-,26+,27+/m0/s1

Standard InChI Key:  BAUZILLUIWQORT-FAULQYQOSA-N

Molfile:  

     RDKit          2D

 38 44  0  0  0  0  0  0  0  0999 V2000
   -6.7623   -4.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1249   -3.4457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1378   -5.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9041   -2.9572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3959   -3.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0060   -1.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4907   -1.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3724   -2.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2705   -4.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6296   -5.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2396   -4.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7243   -4.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6060   -5.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9960   -6.8732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5042   -7.0300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -1.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8102   -0.3422    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3739   -0.6015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1285   -6.6851    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7995   -5.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4309   -5.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3513   -6.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8285   -4.5618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    1.7500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7883   -2.0868    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5474   -3.4979    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  2 21  1  0
 20  3  1  0
  3  1  1  0
  4  5  1  0
  4  7  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  8  9  1  0
  8 12  1  0
  9 10  1  0
 10 11  1  0
 11 13  1  0
 12 13  1  0
 13 16  1  0
 15 14  1  0
 14 12  1  0
 15 16  1  0
 15 19  1  0
 16 17  1  0
 17 18  1  0
 18  1  1  0
  1 19  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  5 26  1  1
  8 27  1  1
 13 28  1  1
 16 29  1  1
 20 30  1  1
 23 31  1  1
 19 32  1  6
  3 33  1  6
 19 34  1  0
 15 34  1  6
  9 35  1  6
 12 36  1  6
 21 37  1  6
 10 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3786249

    ---

Associated Targets(non-human)

Trachea (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 459.63Molecular Weight (Monoisotopic): 459.2985AlogP: 2.59#Rotatable Bonds:
Polar Surface Area: 91.32Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.37CX Basic pKa: 9.90CX LogP: 1.72CX LogD: -0.71
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: 2.84

References

1. Li Y, Yili A, Li J, Muhamat A, Aisa HA..  (2016)  New isosteroidal alkaloids with tracheal relaxant effect from the bulbs of Fritillaria pallidiflora Schrenk.,  26  (8): [PMID:26965859] [10.1016/j.bmcl.2016.03.001]

Source