20S,22S,25S,5alpha-veratramine-14,15,16,17-tetradehydro-3beta,23beta-diol-6-one

ID: ALA3786439

PubChem CID: 127031862

Max Phase: Preclinical

Molecular Formula: C27H39NO3

Molecular Weight: 425.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c([C@H](C)[C@@H]2NC[C@@H](C)C[C@H]2O)ccc2c1C[C@H]1[C@H]2CC(=O)[C@H]2C[C@@H](O)CC[C@@]21C

Standard InChI:  InChI=1S/C27H39NO3/c1-14-9-25(31)26(28-13-14)16(3)18-5-6-19-20(15(18)2)11-22-21(19)12-24(30)23-10-17(29)7-8-27(22,23)4/h5-6,14,16-17,21-23,25-26,28-29,31H,7-13H2,1-4H3/t14-,16-,17-,21-,22-,23+,25+,26-,27+/m0/s1

Standard InChI Key:  UJPTWYUILIIDCK-YWUKSBHUSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    2.0080   -6.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2944   -5.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3424   -3.9196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7182   -5.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7320   -3.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9556   -3.1067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0740   -1.6094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7995   -0.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3101   -6.0578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3192   -4.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8422   -2.6442    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6874   -3.9879    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5635   -2.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4812   -1.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9564   -3.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8027   -2.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9043   -1.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4861    0.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9739    0.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9160   -0.6294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3057   -2.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3763   -0.9734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4056    0.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1494    0.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2355    2.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5755    3.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8293    2.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7432    0.7513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0841    0.3482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6444    4.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7214   -2.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0158   -2.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5623   -0.5358    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1455   -1.0692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2416   -0.4300    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5 13  1  0
  6  7  1  0
  7  8  1  0
  8 14  1  0
  2  9  1  1
  5 10  1  1
  6 11  1  6
 13 12  1  6
 13 14  1  0
 14 17  1  0
 16 15  1  0
 15 13  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 24 29  1  1
 26 30  1  1
 22 31  1  6
 21 32  1  0
 14 33  1  1
  7 34  2  0
 23 35  1  1
M  END

Alternative Forms

  1. Parent:

    ALA3786439

    ---

Associated Targets(non-human)

Trachea (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 425.61Molecular Weight (Monoisotopic): 425.2930AlogP: 3.85#Rotatable Bonds: 2
Polar Surface Area: 69.56Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.80CX LogP: 3.90CX LogD: 1.55
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.67Np Likeness Score: 2.54

References

1. Li Y, Yili A, Li J, Muhamat A, Aisa HA..  (2016)  New isosteroidal alkaloids with tracheal relaxant effect from the bulbs of Fritillaria pallidiflora Schrenk.,  26  (8): [PMID:26965859] [10.1016/j.bmcl.2016.03.001]

Source