The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-hydroxy-3-(4-(2-(naphthalen-1-yl)ethyl)-1,4-diazepan-1-yl)quinoline-5-carboxylic acid ID: ALA3786644
PubChem CID: 127030712
Max Phase: Preclinical
Molecular Formula: C27H27N3O3
Molecular Weight: 441.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(O)c2ncc(N3CCCN(CCc4cccc5ccccc45)CC3)cc12
Standard InChI: InChI=1S/C27H27N3O3/c31-25-10-9-23(27(32)33)24-17-21(18-28-26(24)25)30-13-4-12-29(15-16-30)14-11-20-7-3-6-19-5-1-2-8-22(19)20/h1-3,5-10,17-18,31H,4,11-16H2,(H,32,33)
Standard InChI Key: FNBWHWMNQCOYDE-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2613 3.5999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3396 3.5967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9086 1.5029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8118 3.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9120 4.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3951 3.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1618 0.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1443 2.5024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5954 1.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.6432 2.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4861 1.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9830 1.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.9708 1.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.1331 2.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6394 2.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.3136 0.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.8199 0.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1626 -1.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.9991 -2.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.4928 -2.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.1500 -0.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
11 13 2 0
7 14 1 0
1 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
15 19 1 0
18 20 1 0
19 21 1 0
20 21 1 0
20 22 1 0
22 23 1 0
23 24 1 0
24 29 2 0
28 25 2 0
25 26 1 0
26 27 2 0
27 24 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.53Molecular Weight (Monoisotopic): 441.2052AlogP: 4.55#Rotatable Bonds: 5Polar Surface Area: 76.90Molecular Species: ZWITTERIONHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.61CX Basic pKa: 9.68CX LogP: 1.77CX LogD: 1.76Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -0.91
References 1. McAllister TE, England KS, Hopkinson RJ, Brennan PE, Kawamura A, Schofield CJ.. (2016) Recent Progress in Histone Demethylase Inhibitors., 59 (4): [PMID:26710088 ] [10.1021/acs.jmedchem.5b01758 ]