Dongbeinine

ID: ALA3786646

PubChem CID: 127031870

Max Phase: Preclinical

Molecular Formula: C27H43NO2

Molecular Weight: 413.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1CC[C@H]2[C@@H](C)[C@H]3CC[C@@H]4[C@@H](C[C@H]5[C@H]4CC(=O)[C@H]4C[C@@H](O)CC[C@@]45C)[C@@H]3CN2C1

Standard InChI:  InChI=1S/C27H43NO2/c1-15-4-7-25-16(2)18-5-6-19-20(22(18)14-28(25)13-15)11-23-21(19)12-26(30)24-10-17(29)8-9-27(23,24)3/h15-25,29H,4-14H2,1-3H3/t15-,16-,17-,18+,19+,20+,21-,22+,23-,24+,25-,27+/m0/s1

Standard InChI Key:  MWBJDDYEYGDWCZ-LZCHMAFYSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -6.4896   -4.6894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4500   -2.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4500   -4.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1200   -4.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1200   -1.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7800   -2.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7800   -4.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4500   -4.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1200   -4.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4300   -1.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1000   -2.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1200   -0.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3500   -0.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0200   -1.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5400   -1.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4100   -0.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2300    1.1100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7700    1.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6400    2.2900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5400    2.5200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4100    3.8200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9700    3.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8000    4.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1100    6.3900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5900    6.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7200    5.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7713   -1.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4500   -6.0600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7816   -5.0900    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2340   -1.2553    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8177   -3.0073    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3513   -2.4735    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1596    0.7104    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2330    1.1872    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7668    0.9301    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9675    3.6392    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0641    7.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8363    2.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  2  5  1  0
  3  4  1  0
  4  7  1  0
  6  5  1  0
  6  7  1  0
  6 10  1  0
  7  8  1  0
  8  9  1  0
  9 11  1  0
 10 11  1  0
 11 14  1  0
 13 12  1  0
 12 10  1  0
 13 14  1  0
 13 17  1  0
 14 15  1  0
 15 16  1  0
 16 18  1  0
 17 18  1  0
 17 20  1  0
 18 19  1  0
 19 22  1  0
 21 20  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
  6 27  1  1
  8 28  2  0
  7 29  1  6
 10 30  1  6
 11 31  1  1
 14 32  1  6
 13 33  1  6
 17 34  1  1
 18 35  1  6
  3  1  1  1
 22 36  1  6
 25 37  1  1
 19 38  1  1
M  END

Alternative Forms

  1. Parent:

    ALA3786646

    ---

Associated Targets(non-human)

Trachea (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 413.65Molecular Weight (Monoisotopic): 413.3294AlogP: 4.77#Rotatable Bonds:
Polar Surface Area: 40.54Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.26CX LogP: 4.30CX LogD: 1.53
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.62Np Likeness Score: 2.57

References

1. Li Y, Yili A, Li J, Muhamat A, Aisa HA..  (2016)  New isosteroidal alkaloids with tracheal relaxant effect from the bulbs of Fritillaria pallidiflora Schrenk.,  26  (8): [PMID:26965859] [10.1016/j.bmcl.2016.03.001]

Source