Methyl 2-Cyano-3,12-dioxoolean-9(11)-en-28-oate

ID: ALA3786691

PubChem CID: 12019715

Max Phase: Preclinical

Molecular Formula: C32H45NO4

Molecular Weight: 507.72

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)[C@]12CCC(C)(C)C[C@H]1[C@H]1C(=O)C=C3[C@@]4(C)CC(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2

Standard InChI:  InChI=1S/C32H45NO4/c1-27(2)11-13-32(26(36)37-8)14-12-31(7)24(20(32)17-27)21(34)15-23-29(5)16-19(18-33)25(35)28(3,4)22(29)9-10-30(23,31)6/h15,19-20,22,24H,9-14,16-17H2,1-8H3/t19?,20-,22-,24-,29-,30+,31+,32-/m0/s1

Standard InChI Key:  HGVYQVLVRFQQTM-BVVQCZFUSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    3.7649    3.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7988    5.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4760    2.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4104    5.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1216    5.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1532    3.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4245    0.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5099    5.8338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6890    4.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0537    2.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4760    1.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1532    5.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3765    3.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4245    3.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1532    0.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7672    5.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1555    7.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7473    1.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4783    8.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6554    3.0338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7473    2.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7672    7.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7447    2.5616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0096    4.9466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4955    3.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0425    4.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5524    0.1891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4883    0.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7776    0.7753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5457    8.5528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4398    8.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0553    0.3922    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2689    6.3224    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5347    7.0336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0317    4.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0467    3.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0858    4.2340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8142    6.0875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  7  1  0
  5 15  1  0
  6  2  1  0
  7  3  1  0
  8 17  1  0
  9  8  1  0
 10  2  1  0
  5 11  1  1
 12  1  1  0
 13  3  1  0
 14  7  2  0
 15 12  1  0
 16  4  1  0
 17 13  1  0
 18  5  1  0
 19  6  1  0
 20  9  1  0
 21 19  1  0
 22 11  2  0
 23 16  1  0
 24 18  1  0
  1 25  1  6
 26 11  1  0
  3 27  1  1
  4 28  1  1
 29  9  1  0
 30  9  1  0
 20 31  2  0
 32 21  1  0
 33 21  1  0
  8 34  1  6
  6 35  1  1
  5  6  1  0
 14 10  1  0
  8  4  1  0
 21 24  1  0
 20 23  1  0
 10 36  2  0
 26 37  1  0
 23 38  1  0
 38 39  3  0
  2 40  1  1
M  END

Alternative Forms

1. Parent:

   

   ALA3786691

   methyl (4aS,6aR,6bS,8aR,12aS,14aR,14bS)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 507.72

Molecular Weight (Monoisotopic): 507.3349

AlogP: 6.46

#Rotatable Bonds: 1

Polar Surface Area: 84.23

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: 2

HBA (Lipinski): 5

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.96

CX Basic pKa: ┄

CX LogP: 6.53

CX LogD: 6.53

Aromatic Rings: ┄

Heavy Atoms: 37

QED Weighted: 0.38

Np Likeness Score: 2.30

References

1. Wong MH, Bryan HK, Copple IM, Jenkins RE, Chiu PH, Bibby J, Berry NG, Kitteringham NR, Goldring CE, O'Neill PM, Park BK..  (2016)  Design and Synthesis of Irreversible Analogues of Bardoxolone Methyl for the Identification of Pharmacologically Relevant Targets and Interaction Sites.,  59  (6): [PMID:26908173] [10.1021/acs.jmedchem.5b01292]

2. Wu J, Kumar S, Wang F, Wang H, Chen L, Arsenault P, Mattern M, Weinstock J..  (2018)  Chemical Approaches to Intervening in Ubiquitin Specific Protease 7 (USP7) Function for Oncology and Immune Oncology Therapies.,  61  (2): [PMID:28768102] [10.1021/acs.jmedchem.7b00498]

Source

Source(1):

• Scientific Literature