The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((6-((4-Chlorophenyl)amino)-2-(p-tolylamino)pyrimidin-4-yl)oxy)-3,5-dimethylbenzonitrile ID: ALA3786888
PubChem CID: 127032824
Max Phase: Preclinical
Molecular Formula: C26H22ClN5O
Molecular Weight: 455.95
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(Nc2nc(Nc3ccc(Cl)cc3)cc(Oc3c(C)cc(C#N)cc3C)n2)cc1
Standard InChI: InChI=1S/C26H22ClN5O/c1-16-4-8-22(9-5-16)30-26-31-23(29-21-10-6-20(27)7-11-21)14-24(32-26)33-25-17(2)12-19(15-28)13-18(25)3/h4-14H,1-3H3,(H2,29,30,31,32)
Standard InChI Key: MBOYWUVYAFHSEQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8864 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9329 -3.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2563 -3.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5795 -7.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5754 -8.7048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9073 5.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9021 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6005 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8863 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5805 -7.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9486 5.8368 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
1 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
10 15 1 0
14 16 1 0
12 17 1 0
17 18 3 0
3 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
7 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
23 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.95Molecular Weight (Monoisotopic): 455.1513AlogP: 7.21#Rotatable Bonds: 6Polar Surface Area: 82.86Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.45CX Basic pKa: 4.29CX LogP: 8.30CX LogD: 8.30Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -1.37
References 1. Meng Q, Chen X, Kang D, Huang B, Li W, Zhan P, Daelemans D, De Clercq E, Pannecouque C, Liu X.. (2016) Design, synthesis and evaluation of novel HIV-1 NNRTIs with dual structural conformations targeting the entrance channel of the NNRTI binding pocket., 115 [PMID:26994843 ] [10.1016/j.ejmech.2016.02.068 ]