The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 3,12-dioxoolean-9(11)-en-28-oate ID: ALA3787129
Cas Number: 218600-50-1
PubChem CID: 10576780
Max Phase: Preclinical
Molecular Formula: C31H46O4
Molecular Weight: 482.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@]12CCC(C)(C)C[C@H]1[C@H]1C(=O)C=C3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2
Standard InChI: InChI=1S/C31H46O4/c1-26(2)13-15-31(25(34)35-8)16-14-30(7)24(19(31)18-26)20(32)17-22-28(5)11-10-23(33)27(3,4)21(28)9-12-29(22,30)6/h17,19,21,24H,9-16,18H2,1-8H3/t19-,21-,24-,28-,29+,30+,31-/m0/s1
Standard InChI Key: ZSKIWSWEZHHVGY-ZTPLMWSVSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
3.7649 3.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7988 5.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4760 2.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4104 5.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1216 5.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1532 3.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4245 0.6784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5099 5.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6890 4.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0537 2.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4760 1.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1532 5.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3765 3.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4245 3.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1532 0.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7672 5.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1555 7.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7473 1.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4783 8.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6554 3.0338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7473 2.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7672 7.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7447 2.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0096 4.9466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4955 3.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0425 4.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5524 0.1891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4883 0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7776 0.7753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5457 8.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4398 8.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0553 0.3922 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.2689 6.3224 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5347 7.0336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0317 4.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8142 6.0875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 7 1 0
5 15 1 0
6 2 1 0
7 3 1 0
8 17 1 0
9 8 1 0
10 2 1 0
5 11 1 1
12 1 1 0
13 3 1 0
14 7 2 0
15 12 1 0
16 4 1 0
17 13 1 0
18 5 1 0
19 6 1 0
20 9 1 0
21 19 1 0
22 11 2 0
23 16 1 0
24 18 1 0
1 25 1 6
26 11 1 0
3 27 1 1
4 28 1 1
29 9 1 0
30 9 1 0
20 31 2 0
32 21 1 0
33 21 1 0
8 34 1 6
6 35 1 1
5 6 1 0
14 10 1 0
8 4 1 0
21 24 1 0
20 23 1 0
10 36 2 0
26 37 1 0
2 38 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.71Molecular Weight (Monoisotopic): 482.3396AlogP: 6.71#Rotatable Bonds: 1Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.74CX LogD: 6.74Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: 2.87
References 1. Wong MH, Bryan HK, Copple IM, Jenkins RE, Chiu PH, Bibby J, Berry NG, Kitteringham NR, Goldring CE, O'Neill PM, Park BK.. (2016) Design and Synthesis of Irreversible Analogues of Bardoxolone Methyl for the Identification of Pharmacologically Relevant Targets and Interaction Sites., 59 (6): [PMID:26908173 ] [10.1021/acs.jmedchem.5b01292 ]