(3S,4R)-1-(1-(1H-1,2,4-Triazole-1-carbonyl)piperidin-4-yl)-4-benzo[d][1,3]dioxol-5-yl)-3-(4-fluorophenyl)azetidin-2-one

ID: ALA3787346

PubChem CID: 127030391

Max Phase: Preclinical

Molecular Formula: C24H22FN5O4

Molecular Weight: 463.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1[C@@H](c2ccc(F)cc2)[C@H](c2ccc3c(c2)OCO3)N1C1CCN(C(=O)n2cncn2)CC1

Standard InChI:  InChI=1S/C24H22FN5O4/c25-17-4-1-15(2-5-17)21-22(16-3-6-19-20(11-16)34-14-33-19)30(23(21)31)18-7-9-28(10-8-18)24(32)29-13-26-12-27-29/h1-6,11-13,18,21-22H,7-10,14H2/t21-,22-/m0/s1

Standard InChI Key:  XRIROGBLGLPXQI-VXKWHMMOSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   -3.9638    2.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4118    2.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0201    1.0775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168    1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2004    4.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7374    4.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2375    5.8944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2124    7.0345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6871    6.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1870    5.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7510   -0.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2474   -1.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2167   -2.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6928   -2.5108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1995   -1.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2301    0.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4524    3.1230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8125    8.1659    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6650   -3.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2616   -4.7843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1415   -3.3848    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.2072   -4.4221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.5260   -3.7074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -12.2538   -2.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7668   -2.0354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  1  1  0
  5  6  2  0
  6 23  1  0
 22  7  1  0
  7  8  2  0
  8  5  1  0
  4  5  1  6
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1  9  1  1
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  3 15  1  0
  2 21  2  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 22  1  0
 12 27  1  0
 18 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3787346

    ---

Associated Targets(Human)

FAAH Tchem Anandamide amidohydrolase (3465 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MGLL Tchem Monoglyceride lipase (1909 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.47Molecular Weight (Monoisotopic): 463.1656AlogP: 2.95#Rotatable Bonds: 3
Polar Surface Area: 89.79Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.44CX LogD: 1.44
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: -0.77

References

1. Brindisi M, Maramai S, Gemma S, Brogi S, Grillo A, Di Cesare Mannelli L, Gabellieri E, Lamponi S, Saponara S, Gorelli B, Tedesco D, Bonfiglio T, Landry C, Jung KM, Armirotti A, Luongo L, Ligresti A, Piscitelli F, Bertucci C, Dehouck MP, Campiani G, Maione S, Ghelardini C, Pittaluga A, Piomelli D, Di Marzo V, Butini S..  (2016)  Development and Pharmacological Characterization of Selective Blockers of 2-Arachidonoyl Glycerol Degradation with Efficacy in Rodent Models of Multiple Sclerosis and Pain.,  59  (6): [PMID:26888301] [10.1021/acs.jmedchem.5b01812]

Source