The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-(Mesityloxy)-6-(m-tolylamino)pyrimidin-2-yl)amino)benzonitrile ID: ALA3787427
PubChem CID: 127033033
Max Phase: Preclinical
Molecular Formula: C27H25N5O
Molecular Weight: 435.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(Nc2cc(Oc3c(C)cc(C)cc3C)nc(Nc3ccc(C#N)cc3)n2)c1
Standard InChI: InChI=1S/C27H25N5O/c1-17-6-5-7-23(14-17)29-24-15-25(33-26-19(3)12-18(2)13-20(26)4)32-27(31-24)30-22-10-8-21(16-28)9-11-22/h5-15H,1-4H3,(H2,29,30,31,32)
Standard InChI Key: LEZWZDBCLWNSKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8864 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9329 -3.1621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2563 -3.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5806 -7.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9073 5.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9021 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6005 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8863 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5795 -7.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5754 -8.7048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9392 3.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
1 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
10 15 1 0
14 16 1 0
12 17 1 0
3 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
7 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 3 0
23 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.53Molecular Weight (Monoisotopic): 435.2059AlogP: 6.86#Rotatable Bonds: 6Polar Surface Area: 82.86Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.02CX Basic pKa: 4.08CX LogP: 8.21CX LogD: 8.21Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.47
References 1. Meng Q, Chen X, Kang D, Huang B, Li W, Zhan P, Daelemans D, De Clercq E, Pannecouque C, Liu X.. (2016) Design, synthesis and evaluation of novel HIV-1 NNRTIs with dual structural conformations targeting the entrance channel of the NNRTI binding pocket., 115 [PMID:26994843 ] [10.1016/j.ejmech.2016.02.068 ]