The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-((1s,3s)-3-(azetidin-1-ylmethyl)cyclobutyl)-5-(3-(((S)-tetrahydro-2H-pyran-2-yl)methoxy)phenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine ID: ALA3787668
PubChem CID: 67035462
Max Phase: Preclinical
Molecular Formula: C26H33N5O2
Molecular Weight: 447.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1c(-c1cccc(OC[C@@H]3CCCCO3)c1)cn2[C@H]1C[C@@H](CN2CCC2)C1
Standard InChI: InChI=1S/C26H33N5O2/c27-25-24-23(19-5-3-7-21(13-19)33-16-22-6-1-2-10-32-22)15-31(26(24)29-17-28-25)20-11-18(12-20)14-30-8-4-9-30/h3,5,7,13,15,17-18,20,22H,1-2,4,6,8-12,14,16H2,(H2,27,28,29)/t18-,20+,22-/m0/s1
Standard InChI Key: UTHVKVUADCCITP-DWLFOUALSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1749 2.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2517 3.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8114 5.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2965 5.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2218 4.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6621 2.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 2.7132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1852 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4488 -3.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6658 -4.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3864 -3.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0187 -6.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4587 -6.5134 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1303 -7.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4455 -7.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7243 -5.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8879 6.3826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4499 7.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5265 8.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0862 10.3491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1608 11.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3242 11.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8840 9.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9586 8.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
4 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 17 1 0
17 7 1 6
19 21 1 6
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 22 1 0
12 26 1 0
26 27 1 0
28 27 1 6
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.58Molecular Weight (Monoisotopic): 447.2634AlogP: 4.29#Rotatable Bonds: 7Polar Surface Area: 78.43Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.31CX LogP: 3.29CX LogD: 1.36Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: -0.58
References 1. Stauffer F, Cowan-Jacob SW, Scheufler C, Furet P.. (2016) Identification of a 5-[3-phenyl-(2-cyclic-ether)-methylether]-4-aminopyrrolo[2,3-d]pyrimidine series of IGF-1R inhibitors., 26 (8): [PMID:26951750 ] [10.1016/j.bmcl.2016.02.074 ] 2. Fairhurst RA, Marsilje TH, Stutz S, Boos A, Niklaus M, Chen B, Jiang S, Lu W, Furet P, McCarthy C, Stauffer F, Guagnano V, Vaupel A, Michellys PY, Schnell C, Jeay S.. (2016) Optimisation of a 5-[3-phenyl-(2-cyclic-ether)-methyl-ether]-4-aminopyrrolopyrimidine series of IGF-1R inhibitors., 26 (8): [PMID:26951753 ] [10.1016/j.bmcl.2016.02.075 ]